Filtered Search Results
Ultramark∣r 1621, Mass Spec Std
CAS: 105809-15-2 Molecular Formula: C6H18N3P3 Molecular Weight (g/mol): 231.189 MDL Number: MFCD00242454 InChI Key: DEBZEVJNWCNATM-MZWXYZOWSA-N PubChem CID: 44119860 IUPAC Name: 2,2,4,4,6,6-hexakis(deuteriomethyl)-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene SMILES: CP1(=NP(=NP(=N1)(C)C)(C)C)C
| PubChem CID | 44119860 |
|---|---|
| CAS | 105809-15-2 |
| Molecular Weight (g/mol) | 231.189 |
| MDL Number | MFCD00242454 |
| SMILES | CP1(=NP(=NP(=N1)(C)C)(C)C)C |
| IUPAC Name | 2,2,4,4,6,6-hexakis(deuteriomethyl)-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene |
| InChI Key | DEBZEVJNWCNATM-MZWXYZOWSA-N |
| Molecular Formula | C6H18N3P3 |
| MDL Number | MFCD00145343 |
|---|
| MDL Number | MFCD00085311 |
|---|
Thermo Scientific Chemicals Iodine, 0.01N Standardized Solution
CAS: 7553-56-2 | I2 | 253.81 g/mol
| Molecular Weight (g/mol) | 253.81 |
|---|---|
| ChEBI | CHEBI:17606 |
| Solubility | Miscible with chloroform, carbon tetrachloride, carbon disulfide, cyclohexane, methanol, ethyl acetate, toluene, benzene, n-hexane, butan-2-ol, bromoethane, n-heptane, glycerol and diethyl ether |
| Color | Red to Brown |
| Physical Form | Liquid |
| Chemical Name or Material | Iodine |
| SMILES | II |
| InChI Key | PNDPGZBMCMUPRI-UHFFFAOYSA-N |
| Vapor Pressure | 23 hPa (17mm Hg) at 20°C |
| PubChem CID | 807 |
| Concentration or Composition (by Analyte or Components) | Iodine: 0.13%; Potassium iodide: 2.5%; Water: 97.37% |
| CAS | 7732-18-5 |
| MDL Number | MFCD00011355 MFCD00164163 |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Molecular Formula | I2 |
| EINECS Number | 231-442-4 |
| Formula Weight | 253.81 |
Sodium hydroxide, 0.1N Standardized Solution
CAS: 1310-73-2 Molecular Formula: HNaO Molecular Weight (g/mol): 39.997 MDL Number: MFCD00003548 InChI Key: HEMHJVSKTPXQMS-UHFFFAOYSA-M PubChem CID: 14798 ChEBI: CHEBI:32145 IUPAC Name: sodium;hydroxide SMILES: [OH-].[Na+]
| PubChem CID | 14798 |
|---|---|
| CAS | 1310-73-2 |
| Molecular Weight (g/mol) | 39.997 |
| ChEBI | CHEBI:32145 |
| MDL Number | MFCD00003548 |
| SMILES | [OH-].[Na+] |
| IUPAC Name | sodium;hydroxide |
| InChI Key | HEMHJVSKTPXQMS-UHFFFAOYSA-M |
| Molecular Formula | HNaO |
| Name Note | NIST Traceable |
|---|---|
| Solubility | Miscible with water |
| MDL Number | MFCD00147253 |
| Physical Form | Liquid |
| Chemical Name or Material | Buffer solution, pH 9.00 (±0.01 at 25°C) |
| Grade | Specpure™ |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
Buffer solution pH 10.00 (+/-0.024 @ 25oC) Colored Blue Specpure NIST Traceable
CAS: 1336-21-6 | H5NO | 35.05 g/mol
Calcium, AAS standard solution, Specpure™ Ca 1000μg/mL
CAS: 471-34-1 Molecular Formula: CCaO3 Molecular Weight (g/mol): 100.09 MDL Number: MFCD00010906 InChI Key: VTYYLEPIZMXCLO-UHFFFAOYSA-L PubChem CID: 10112 ChEBI: CHEBI:3311 SMILES: [Ca++].[O-]C([O-])=O
| PubChem CID | 10112 |
|---|---|
| CAS | 471-34-1 |
| Molecular Weight (g/mol) | 100.09 |
| ChEBI | CHEBI:3311 |
| MDL Number | MFCD00010906 |
| SMILES | [Ca++].[O-]C([O-])=O |
| InChI Key | VTYYLEPIZMXCLO-UHFFFAOYSA-L |
| Molecular Formula | CCaO3 |
Lead, AAS standard solution, Specpure™ Pb 1000μg/mL
CAS: 7439-92-1 Molecular Formula: Pb Molecular Weight (g/mol): 207.20 MDL Number: MFCD00134050 InChI Key: WABPQHHGFIMREM-UHFFFAOYSA-N PubChem CID: 5352425 ChEBI: CHEBI:27889 IUPAC Name: lead SMILES: [Pb]
| PubChem CID | 5352425 |
|---|---|
| CAS | 7439-92-1 |
| Molecular Weight (g/mol) | 207.20 |
| ChEBI | CHEBI:27889 |
| MDL Number | MFCD00134050 |
| SMILES | [Pb] |
| IUPAC Name | lead |
| InChI Key | WABPQHHGFIMREM-UHFFFAOYSA-N |
| Molecular Formula | Pb |
| MDL Number | MFCD00085314 |
|---|
ChromaCare™ LC-MS Instrument Flush Solution
ChromaCare™ LC-MS Instrument Flush Solution is designed to prepare LC/MS instruments for start-up. By reducing background noise, this solution facilitates instrument installation and preventative maintenance routines. ∣ CAS: 75-05-8; 67-56-1; 67-63-0; 7732-18-5
| Percent Purity | 25% Acetonitrile, 25% Methanol, 25% Water, 25% 2-Propanol (IPA) |
|---|---|
| CAS | 75-05-8; 67-56-1; 67-63-0; 7732-18-5 |
| Color | Colorless |
| Physical Form | Liquid |
| Grade | LC-MS |
Copper, AAS standard solution, Specpure™ Cu 1000μg/mL
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |