Organophosphorus compounds
- (2)
- (3)
- (2)
- (2)
- (2)
- (1)
- (2)
- (3)
- (2)
- (2)
- (2)
- (1)
- (1)
- (3)
- (1)
- (3)
- (2)
- (1)
- (1)
- (4)
- (2)
- (2)
Filtered Search Results
Acephate, TRC
CAS: 30560-19-1 Molecular Formula: C4 H10 N O3 P S Molecular Weight (g/mol): 183.17 Synonym: Phosphoramidothioic acid, acetyl-, O,S-dimethyl ester (8CI,9CI),Acefate,Acephate,Acetamidophos,Aciphid,Ant Hayter,Asataf,DMAP,Fire Ant Hayter Bait,Lepitect,O,S-Dimethyl N-acetylphosphoramidothioate,O,S-Dimethyl N-acetylphosphoramidothiolate,O,S-Dimethyl acetylphosphoramidothioate,Orthene,Orthene 75SP,Orthene 97,Orthene PCO,Orthene S,Orthene TTO,Orthene TTO 97,Orthene-755,Ortran,Payload,Precise,RE 12420 IUPAC Name: N-[methoxy(methylsulfanyl)phosphoryl]acetamide SMILES: COP(=O)(NC(=O)C)SC
| CAS | 30560-19-1 |
|---|---|
| Molecular Weight (g/mol) | 183.17 |
| SMILES | COP(=O)(NC(=O)C)SC |
| Synonym | Phosphoramidothioic acid, acetyl-, O,S-dimethyl ester (8CI,9CI),Acefate,Acephate,Acetamidophos,Aciphid,Ant Hayter,Asataf,DMAP,Fire Ant Hayter Bait,Lepitect,O,S-Dimethyl N-acetylphosphoramidothioate,O,S-Dimethyl N-acetylphosphoramidothiolate,O,S-Dimethyl acetylphosphoramidothioate,Orthene,Orthene 75SP,Orthene 97,Orthene PCO,Orthene S,Orthene TTO,Orthene TTO 97,Orthene-755,Ortran,Payload,Precise,RE 12420 |
| IUPAC Name | N-[methoxy(methylsulfanyl)phosphoryl]acetamide |
| Molecular Formula | C4 H10 N O3 P S |
Merphos, TRC
CAS: 150-50-5 Molecular Formula: C12 H27 P S3 Molecular Weight (g/mol): 298.51 Synonym: Butyl phosphorotrithioite (6CI),Butyl phosphorotrithioite ((BuS)3P),Folex,Merphos,NSC 27720,Tributyl phosphorotrithioite,Tributyl trithiophosphite,Tris(butylthio)phosphine IUPAC Name: tris(butylsulfanyl)phosphane SMILES: CCCCSP(SCCCC)SCCCC
| CAS | 150-50-5 |
|---|---|
| Molecular Weight (g/mol) | 298.51 |
| SMILES | CCCCSP(SCCCC)SCCCC |
| Synonym | Butyl phosphorotrithioite (6CI),Butyl phosphorotrithioite ((BuS)3P),Folex,Merphos,NSC 27720,Tributyl phosphorotrithioite,Tributyl trithiophosphite,Tris(butylthio)phosphine |
| IUPAC Name | tris(butylsulfanyl)phosphane |
| Molecular Formula | C12 H27 P S3 |
Phorate Oxon, TRC
CAS: 2600-69-3 Molecular Formula: C7 H17 O3 P S2 Molecular Weight (g/mol): 244.31 Synonym: Phosphorothioic acid, O,O-diethyl S-[(ethylthio)methyl] ester,Methanethiol, (ethylthio)-, S-ester with O,O-diethyl phosphorothioate (8CI),O,O-Diethyl S-(ethylthiomethyl) phosphorothioate,Phorate oxon,Phorate oxygen analog,Phorate thiolate analog,Phoratoxon,Thimet oxon,Thimet oxygen analog,Phorate-oxon IUPAC Name: 1-[ethoxy(ethylsulfanylmethylsulfanyl)phosphoryl]oxyethane SMILES: CCOP(=O)(OCC)SCSCC
| CAS | 2600-69-3 |
|---|---|
| Molecular Weight (g/mol) | 244.31 |
| SMILES | CCOP(=O)(OCC)SCSCC |
| Synonym | Phosphorothioic acid, O,O-diethyl S-[(ethylthio)methyl] ester,Methanethiol, (ethylthio)-, S-ester with O,O-diethyl phosphorothioate (8CI),O,O-Diethyl S-(ethylthiomethyl) phosphorothioate,Phorate oxon,Phorate oxygen analog,Phorate thiolate analog,Phoratoxon,Thimet oxon,Thimet oxygen analog,Phorate-oxon |
| IUPAC Name | 1-[ethoxy(ethylsulfanylmethylsulfanyl)phosphoryl]oxyethane |
| Molecular Formula | C7 H17 O3 P S2 |
Tetrabutylphosphonium Chloride, TRC
CAS: 2304-30-5 Molecular Formula: C16H36ClP Molecular Weight (g/mol): 294.88 Synonym: Cyphos 443P,Cyphos 443T,Cyphos IL 164,Hishicolin PX 4C,Tetra-n-butylphosphonium Chloride IUPAC Name: tetrabutylphosphanium;chloride SMILES: [Cl-].CCCC[P+](CCCC)(CCCC)CCCC
| CAS | 2304-30-5 |
|---|---|
| Molecular Weight (g/mol) | 294.88 |
| SMILES | [Cl-].CCCC[P+](CCCC)(CCCC)CCCC |
| Synonym | Cyphos 443P,Cyphos 443T,Cyphos IL 164,Hishicolin PX 4C,Tetra-n-butylphosphonium Chloride |
| IUPAC Name | tetrabutylphosphanium;chloride |
| Molecular Formula | C16H36ClP |
Metamidophos (>90%), TRC
CAS: 10265-92-6 Molecular Formula: C2 H8 N O2 P S Molecular Weight (g/mol): 141.13 Synonym: Methamidophos IUPAC Name: [amino(methylsulfanyl)phosphoryl]oxymethane SMILES: COP(=O)(N)SC
| CAS | 10265-92-6 |
|---|---|
| Molecular Weight (g/mol) | 141.13 |
| SMILES | COP(=O)(N)SC |
| Synonym | Methamidophos |
| IUPAC Name | [amino(methylsulfanyl)phosphoryl]oxymethane |
| Molecular Formula | C2 H8 N O2 P S |
1,2,4-Tributyl Phosphorotrithioate, TRC
CAS: 78-48-8 Molecular Formula: C12 H27 O P S3 Molecular Weight (g/mol): 314.51 Synonym: Butyl phosphorotrithioate (6CI),B 1,776,Butiphos,Butyl phosphorotrithioate ((BuS)3PO),Chemagro B 1776,DEF,DEF (defoliant),DEF 6,De-Green,Fos-Fall A,Fosfall,S,S,S-Tributyl phosphorotrithioate,S,S,S-Tributyl trithiophosphate,TBPT,TBTP,Tribufos IUPAC Name: 1-bis(butylsulfanyl)phosphorylsulfanylbutane SMILES: CCCCSP(=O)(SCCCC)SCCCC
| CAS | 78-48-8 |
|---|---|
| Molecular Weight (g/mol) | 314.51 |
| SMILES | CCCCSP(=O)(SCCCC)SCCCC |
| Synonym | Butyl phosphorotrithioate (6CI),B 1,776,Butiphos,Butyl phosphorotrithioate ((BuS)3PO),Chemagro B 1776,DEF,DEF (defoliant),DEF 6,De-Green,Fos-Fall A,Fosfall,S,S,S-Tributyl phosphorotrithioate,S,S,S-Tributyl trithiophosphate,TBPT,TBTP,Tribufos |
| IUPAC Name | 1-bis(butylsulfanyl)phosphorylsulfanylbutane |
| Molecular Formula | C12 H27 O P S3 |
Demeton-S-methyl, TRC
CAS: 919-86-8 Molecular Formula: C6 H15 O3 P S2 Molecular Weight (g/mol): 230.29 Synonym: Phosphorothioic acid, S-[2-(ethylthio)ethyl] O,O-di-Me ester (6CI),Demeton-S-methyl,Metaisoseptox,Metaisosystox,Metasystox 55,Metasystox I,Metasystox J,Methyl demeton thioester,Methyl isosystox,Methylthionodemeton,O,O-Dimethyl S-2-(ethylthio)ethyl phosphorothioate,S-[2-(Ethylthio)ethyl] O,O-dimethyl phosphorothioate,S-[2-(Ethylthio)ethyl] O,O-dimethyl thiophosphate,Thiometon oxon IUPAC Name: 1-dimethoxyphosphorylsulfanyl-2-ethylsulfanylethane SMILES: CCSCCSP(=O)(OC)OC
| CAS | 919-86-8 |
|---|---|
| Molecular Weight (g/mol) | 230.29 |
| SMILES | CCSCCSP(=O)(OC)OC |
| Synonym | Phosphorothioic acid, S-[2-(ethylthio)ethyl] O,O-di-Me ester (6CI),Demeton-S-methyl,Metaisoseptox,Metaisosystox,Metasystox 55,Metasystox I,Metasystox J,Methyl demeton thioester,Methyl isosystox,Methylthionodemeton,O,O-Dimethyl S-2-(ethylthio)ethyl phosphorothioate,S-[2-(Ethylthio)ethyl] O,O-dimethyl phosphorothioate,S-[2-(Ethylthio)ethyl] O,O-dimethyl thiophosphate,Thiometon oxon |
| IUPAC Name | 1-dimethoxyphosphorylsulfanyl-2-ethylsulfanylethane |
| Molecular Formula | C6 H15 O3 P S2 |
Demeton (O&S), TRC
CAS: 8065-48-3 Molecular Formula: 2 C8 H19 O3 P S2 Molecular Weight (g/mol): 516.68 Synonym: Phosphorothioic acid, O,O-diethyl S-[2-(ethylthio)ethyl] ester, mixt. contg. (9CI),Bayer 8169,Demeton,E 1059,Ethyl systox,Mercaptofos,Mercaptophos,Phosphorothioic acid O,O-diethyl O-[2-(ethylthio)ethyl] ester mixture with O,O-diethyl S-[2-(ethylthio)ethyl]phosphorothioate,Septox,Systox IUPAC Name: diethoxy-(2-ethylsulfanylethoxy)-sulfanylidene-λ^{5}-phosphane;1-diethoxyphosphorylsulfanyl-2-ethylsulfanylethane SMILES: CCOP(=S)(OCC)OCCSCC.CCOP(=O)(OCC)SCCSCC
| CAS | 8065-48-3 |
|---|---|
| Molecular Weight (g/mol) | 516.68 |
| SMILES | CCOP(=S)(OCC)OCCSCC.CCOP(=O)(OCC)SCCSCC |
| Synonym | Phosphorothioic acid, O,O-diethyl S-[2-(ethylthio)ethyl] ester, mixt. contg. (9CI),Bayer 8169,Demeton,E 1059,Ethyl systox,Mercaptofos,Mercaptophos,Phosphorothioic acid O,O-diethyl O-[2-(ethylthio)ethyl] ester mixture with O,O-diethyl S-[2-(ethylthio)ethyl]phosphorothioate,Septox,Systox |
| IUPAC Name | diethoxy-(2-ethylsulfanylethoxy)-sulfanylidene-λ^{5}-phosphane;1-diethoxyphosphorylsulfanyl-2-ethylsulfanylethane |
| Molecular Formula | 2 C8 H19 O3 P S2 |
O,O,S-Triethyl Phosphorothiolate, TRC
CAS: 1186-09-0 Molecular Formula: C6 H15 O3 P S Molecular Weight (g/mol): 198.22 Synonym: Phosphorothioic acid, O,O,S-triethyl ester,Ethyl phosphorothioate ((EtO)2(EtS)PO) (6CI),Ethyl thiophosphate ((EtO)2(EtS)PO) (5CI),O,O,S-Triethyl phosphorothioate,O,O,S-Triethyl phosphorothiolate,O,O,S-Triethyl thiophosphate,O,O-Diethyl S-ethyl phosphorothioate,Thiophosphoric acid O,O,S-triethyl ester,Triethyl phosphorothioate IUPAC Name: 1-[ethoxy(ethylsulfanyl)phosphoryl]oxyethane SMILES: CCOP(=O)(OCC)SCC
| CAS | 1186-09-0 |
|---|---|
| Molecular Weight (g/mol) | 198.22 |
| SMILES | CCOP(=O)(OCC)SCC |
| Synonym | Phosphorothioic acid, O,O,S-triethyl ester,Ethyl phosphorothioate ((EtO)2(EtS)PO) (6CI),Ethyl thiophosphate ((EtO)2(EtS)PO) (5CI),O,O,S-Triethyl phosphorothioate,O,O,S-Triethyl phosphorothiolate,O,O,S-Triethyl thiophosphate,O,O-Diethyl S-ethyl phosphorothioate,Thiophosphoric acid O,O,S-triethyl ester,Triethyl phosphorothioate |
| IUPAC Name | 1-[ethoxy(ethylsulfanyl)phosphoryl]oxyethane |
| Molecular Formula | C6 H15 O3 P S |