Organophosphorus compounds
Filtered Search Results
tert-Butyldichlorophosphine, Thermo Scientific Chemicals
CAS: 25979-07-1 Molecular Formula: C4H9Cl2P Molecular Weight (g/mol): 158.98 MDL Number: MFCD00013615 InChI Key: NMJASRUOIRRDSX-UHFFFAOYSA-N Synonym: tert-butyldichlorophosphine,t-butyldichlorophosphine,tert-c4h9pcl2,tert-butyl dichloro phosphane,phosphonous dichloride, 1,1-dimethylethyl,snpladsptpdwuup@,pubchem6471,acmc-1cmec,tert-butyl dichloro phosphine,tert-butylphosphine dichloride PubChem CID: 117690 IUPAC Name: tert-butyl(dichloro)phosphane SMILES: CC(C)(C)P(Cl)Cl
| PubChem CID | 117690 |
|---|---|
| CAS | 25979-07-1 |
| Molecular Weight (g/mol) | 158.98 |
| MDL Number | MFCD00013615 |
| SMILES | CC(C)(C)P(Cl)Cl |
| Synonym | tert-butyldichlorophosphine,t-butyldichlorophosphine,tert-c4h9pcl2,tert-butyl dichloro phosphane,phosphonous dichloride, 1,1-dimethylethyl,snpladsptpdwuup@,pubchem6471,acmc-1cmec,tert-butyl dichloro phosphine,tert-butylphosphine dichloride |
| IUPAC Name | tert-butyl(dichloro)phosphane |
| InChI Key | NMJASRUOIRRDSX-UHFFFAOYSA-N |
| Molecular Formula | C4H9Cl2P |
Triisopropyl phosphite, 90+%, Thermo Scientific Chemicals
CAS: 116-17-6 Molecular Formula: C9H21O3P Molecular Weight (g/mol): 208.238 MDL Number: MFCD00008874 InChI Key: SJHCUXCOGGKFAI-UHFFFAOYSA-N Synonym: triisopropyl phosphite,tri-2-propyl phosphite,phosphorous acid, tris 1-methylethyl ester,isopropyl phosphite, tri,triisopropoxyphosphine,phosphorous acid, triisopropyl ester,tri-2-propylphosphite,unii-rj7qu4yqun,triisopropylphosphite,tri-i-propylphosphite PubChem CID: 8304 IUPAC Name: tripropan-2-yl phosphite SMILES: CC(C)OP(OC(C)C)OC(C)C
| PubChem CID | 8304 |
|---|---|
| CAS | 116-17-6 |
| Molecular Weight (g/mol) | 208.238 |
| MDL Number | MFCD00008874 |
| SMILES | CC(C)OP(OC(C)C)OC(C)C |
| Synonym | triisopropyl phosphite,tri-2-propyl phosphite,phosphorous acid, tris 1-methylethyl ester,isopropyl phosphite, tri,triisopropoxyphosphine,phosphorous acid, triisopropyl ester,tri-2-propylphosphite,unii-rj7qu4yqun,triisopropylphosphite,tri-i-propylphosphite |
| IUPAC Name | tripropan-2-yl phosphite |
| InChI Key | SJHCUXCOGGKFAI-UHFFFAOYSA-N |
| Molecular Formula | C9H21O3P |
Triisopropyl phosphite, 96%, Thermo Scientific Chemicals
CAS: 116-17-6 Molecular Formula: C9H21O3P Molecular Weight (g/mol): 208.24 InChI Key: SJHCUXCOGGKFAI-UHFFFAOYSA-N Synonym: triisopropyl phosphite,tri-2-propyl phosphite,phosphorous acid, tris 1-methylethyl ester,isopropyl phosphite, tri,triisopropoxyphosphine,phosphorous acid, triisopropyl ester,tri-2-propylphosphite,unii-rj7qu4yqun,triisopropylphosphite,tri-i-propylphosphite PubChem CID: 8304 IUPAC Name: tripropan-2-yl phosphite SMILES: CC(C)OP(OC(C)C)OC(C)C
| PubChem CID | 8304 |
|---|---|
| CAS | 116-17-6 |
| Molecular Weight (g/mol) | 208.24 |
| SMILES | CC(C)OP(OC(C)C)OC(C)C |
| Synonym | triisopropyl phosphite,tri-2-propyl phosphite,phosphorous acid, tris 1-methylethyl ester,isopropyl phosphite, tri,triisopropoxyphosphine,phosphorous acid, triisopropyl ester,tri-2-propylphosphite,unii-rj7qu4yqun,triisopropylphosphite,tri-i-propylphosphite |
| IUPAC Name | tripropan-2-yl phosphite |
| InChI Key | SJHCUXCOGGKFAI-UHFFFAOYSA-N |
| Molecular Formula | C9H21O3P |
Bis(3-aminopropyl)phenylphosphine, Thermo Scientific Chemicals
CAS: 6775-01-5 Molecular Formula: C12H21N2P Molecular Weight (g/mol): 224.29 MDL Number: MFCD00014834 InChI Key: OEHBMEXOPYWPKQ-UHFFFAOYSA-N Synonym: bis 3-aminopropyl phenylphosphine,3,3'-phenylphosphinediyl bis propan-1-amine,3-3-aminopropyl phenyl phosphanyl propan-1-amine,bis 3-aminopropyl phenyl phosphane,1-propanamine,3,3'-phenylphosphinidene bis-9ci,bis 3-aminopropyl phenylphosphine, packaged under argon in resealable chemseal bottles PubChem CID: 138827 IUPAC Name: 3-[3-aminopropyl(phenyl)phosphanyl]propan-1-amine SMILES: NCCCP(CCCN)C1=CC=CC=C1
| PubChem CID | 138827 |
|---|---|
| CAS | 6775-01-5 |
| Molecular Weight (g/mol) | 224.29 |
| MDL Number | MFCD00014834 |
| SMILES | NCCCP(CCCN)C1=CC=CC=C1 |
| Synonym | bis 3-aminopropyl phenylphosphine,3,3'-phenylphosphinediyl bis propan-1-amine,3-3-aminopropyl phenyl phosphanyl propan-1-amine,bis 3-aminopropyl phenyl phosphane,1-propanamine,3,3'-phenylphosphinidene bis-9ci,bis 3-aminopropyl phenylphosphine, packaged under argon in resealable chemseal bottles |
| IUPAC Name | 3-[3-aminopropyl(phenyl)phosphanyl]propan-1-amine |
| InChI Key | OEHBMEXOPYWPKQ-UHFFFAOYSA-N |
| Molecular Formula | C12H21N2P |
Bis(triethylphosphine)palladium(II) chloride, Thermo Scientific Chemicals
CAS: 28425-04-9 Molecular Formula: C12H30Cl2P2Pd Molecular Weight (g/mol): 413.64 MDL Number: MFCD00191831 InChI Key: ULYNIEUXPCUIEL-UHFFFAOYSA-L Synonym: dichlorobis triethylphosphine palladium ii,bis triethylphosphine palladium dichloride,trans-dichlorobis triethylphosphine palladium ii,bis triethylphosphine palladium ii chloride,pdcl2 pet3 2,palladium,dichlorobis triethylphosphine,dichloropalladium-triethylphosphane 1/2,bis triethylphosphine dichloridopalladium ii PubChem CID: 11144124 IUPAC Name: dichloropalladium;triethylphosphane SMILES: Cl[Pd]Cl.CCP(CC)CC.CCP(CC)CC
| PubChem CID | 11144124 |
|---|---|
| CAS | 28425-04-9 |
| Molecular Weight (g/mol) | 413.64 |
| MDL Number | MFCD00191831 |
| SMILES | Cl[Pd]Cl.CCP(CC)CC.CCP(CC)CC |
| Synonym | dichlorobis triethylphosphine palladium ii,bis triethylphosphine palladium dichloride,trans-dichlorobis triethylphosphine palladium ii,bis triethylphosphine palladium ii chloride,pdcl2 pet3 2,palladium,dichlorobis triethylphosphine,dichloropalladium-triethylphosphane 1/2,bis triethylphosphine dichloridopalladium ii |
| IUPAC Name | dichloropalladium;triethylphosphane |
| InChI Key | ULYNIEUXPCUIEL-UHFFFAOYSA-L |
| Molecular Formula | C12H30Cl2P2Pd |
O,S-Diethyl methylphosphonothioate, 97%, Thermo Scientific Chemicals
CAS: 2511-10-6 MDL Number: MFCD01705977
| CAS | 2511-10-6 |
|---|---|
| MDL Number | MFCD01705977 |
(2S,4S)-(-)-2,4-Bis(diphenylphosphino)pentane, 99%, Thermo Scientific Chemicals
CAS: 77876-39-2 Molecular Formula: C29H30P2 Molecular Weight (g/mol): 440.51 MDL Number: MFCD00058923 InChI Key: CTYPJIUQROQJBG-ISIPKWIHNA-N Synonym: 2s,4s---2,4-bis diphenylphosphino pentane,s,s-bdpp,2s,4s-pentane-2,4-diylbis diphenylphosphine,phosphine, 1s,3s-1,3-dimethyl-1,3-propanediyl bis diphenyl,s,s-2,4-bis diphenylphosphino pentane,2s,4s-2,4-bis diphenylphosphino pentane,1s,3s-1,3-dimethyl-1,3-propanediyl bis diphenylphosphine,2s,4s-4-diphenylphosphanylpentan-2-yl-diphenylphosphane,2s,4s-4-diphenylphosphanyl pentan-2-yl diphenylphosphane PubChem CID: 2734567 SMILES: C[C@@H](C[C@H](C)P(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 2734567 |
|---|---|
| CAS | 77876-39-2 |
| Molecular Weight (g/mol) | 440.51 |
| MDL Number | MFCD00058923 |
| SMILES | C[C@@H](C[C@H](C)P(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2s,4s---2,4-bis diphenylphosphino pentane,s,s-bdpp,2s,4s-pentane-2,4-diylbis diphenylphosphine,phosphine, 1s,3s-1,3-dimethyl-1,3-propanediyl bis diphenyl,s,s-2,4-bis diphenylphosphino pentane,2s,4s-2,4-bis diphenylphosphino pentane,1s,3s-1,3-dimethyl-1,3-propanediyl bis diphenylphosphine,2s,4s-4-diphenylphosphanylpentan-2-yl-diphenylphosphane,2s,4s-4-diphenylphosphanyl pentan-2-yl diphenylphosphane |
| InChI Key | CTYPJIUQROQJBG-ISIPKWIHNA-N |
| Molecular Formula | C29H30P2 |
(1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine, 97%, Thermo Scientific Chemicals
CAS: 1091606-67-5 Molecular Formula: C26H24NP Molecular Weight (g/mol): 381.46 MDL Number: MFCD11045444 InChI Key: MIPGTOGPLXZBQX-QYRYXDJWNA-N Synonym: 1s,2s-2-diphenylphosphino-1,2-diphenylethanamine,1s,2s-2-diphenylphosphino-1,2-diphenylethylamine,1s,2s-2-amino-1,2-diphenylethyl diphenylphosphane,1s,2s-1,2-diphenyl-2-aminoethyl diphenylphosphine,1s,2s-2-diphenylphosphanyl-1,2-diphenylethan-1-amine,s,s-+-2-diphenylphosphino-1,2-diphenylethylamine,1s,2s-2-diphenylphosphino-1,2-diphenylethylamine, kanata purity PubChem CID: 46177587 IUPAC Name: (1S,2S)-2-diphenylphosphanyl-1,2-diphenylethanamine SMILES: N[C@H]([C@@H](P(C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 46177587 |
|---|---|
| CAS | 1091606-67-5 |
| Molecular Weight (g/mol) | 381.46 |
| MDL Number | MFCD11045444 |
| SMILES | N[C@H]([C@@H](P(C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 1s,2s-2-diphenylphosphino-1,2-diphenylethanamine,1s,2s-2-diphenylphosphino-1,2-diphenylethylamine,1s,2s-2-amino-1,2-diphenylethyl diphenylphosphane,1s,2s-1,2-diphenyl-2-aminoethyl diphenylphosphine,1s,2s-2-diphenylphosphanyl-1,2-diphenylethan-1-amine,s,s-+-2-diphenylphosphino-1,2-diphenylethylamine,1s,2s-2-diphenylphosphino-1,2-diphenylethylamine, kanata purity |
| IUPAC Name | (1S,2S)-2-diphenylphosphanyl-1,2-diphenylethanamine |
| InChI Key | MIPGTOGPLXZBQX-QYRYXDJWNA-N |
| Molecular Formula | C26H24NP |
1,2-Bis(dicyclohexylphosphino)ethane, 98%
CAS: 23743-26-2 Molecular Formula: C26H48P2 Molecular Weight (g/mol): 422.61 MDL Number: MFCD00015521 InChI Key: BOUYBUIVMHNXQB-UHFFFAOYSA-N Synonym: 1,2-bis dicyclohexylphosphino ethane,ethylenebis dicyclohexylphosphine,phosphine, 1,2-ethanediylbis dicyclohexyl,1,2-ethanediylbis dicyclohexyl phosphine,dicyclohexyl 2-dicyclohexylphosphanylethyl phosphane,bis 1,2-dicyclohexylphosphino ethane,pubchem6558,acmc-1capw,ethane-1,2-diylbis dicyclohexylphosphane,phosphine, 1,2-ethanediylbis*dicyclohexyl PubChem CID: 534202 IUPAC Name: dicyclohexyl(2-dicyclohexylphosphanylethyl)phosphane SMILES: C1CCC(CC1)P(CCP(C2CCCCC2)C3CCCCC3)C4CCCCC4
| PubChem CID | 534202 |
|---|---|
| CAS | 23743-26-2 |
| Molecular Weight (g/mol) | 422.61 |
| MDL Number | MFCD00015521 |
| SMILES | C1CCC(CC1)P(CCP(C2CCCCC2)C3CCCCC3)C4CCCCC4 |
| Synonym | 1,2-bis dicyclohexylphosphino ethane,ethylenebis dicyclohexylphosphine,phosphine, 1,2-ethanediylbis dicyclohexyl,1,2-ethanediylbis dicyclohexyl phosphine,dicyclohexyl 2-dicyclohexylphosphanylethyl phosphane,bis 1,2-dicyclohexylphosphino ethane,pubchem6558,acmc-1capw,ethane-1,2-diylbis dicyclohexylphosphane,phosphine, 1,2-ethanediylbis*dicyclohexyl |
| IUPAC Name | dicyclohexyl(2-dicyclohexylphosphanylethyl)phosphane |
| InChI Key | BOUYBUIVMHNXQB-UHFFFAOYSA-N |
| Molecular Formula | C26H48P2 |
Tetramethylphosphonium bromide, 97%
CAS: 4519-28-2 Molecular Formula: C4H12BrP Molecular Weight (g/mol): 171.02 MDL Number: MFCD00011802 InChI Key: ZTXFOCMYRCGSMU-UHFFFAOYSA-M Synonym: tetramethylphosphonium bromide,tetramethylphosphanium bromide,acmc-1ai8x,ch3 4pbr,tetramethyl phosphonium bromide,phosphonium, tetramethyl-, bromide PubChem CID: 357594 IUPAC Name: tetramethylphosphanium;bromide SMILES: [Br-].C[P+](C)(C)C
| PubChem CID | 357594 |
|---|---|
| CAS | 4519-28-2 |
| Molecular Weight (g/mol) | 171.02 |
| MDL Number | MFCD00011802 |
| SMILES | [Br-].C[P+](C)(C)C |
| Synonym | tetramethylphosphonium bromide,tetramethylphosphanium bromide,acmc-1ai8x,ch3 4pbr,tetramethyl phosphonium bromide,phosphonium, tetramethyl-, bromide |
| IUPAC Name | tetramethylphosphanium;bromide |
| InChI Key | ZTXFOCMYRCGSMU-UHFFFAOYSA-M |
| Molecular Formula | C4H12BrP |
[1,3-Bis(diphenylphosphino)propane]nickel(II) chloride, 98+%
CAS: 15629-92-2 Molecular Formula: C27H26Cl2NiP2 Molecular Weight (g/mol): 542.04 MDL Number: MFCD00015318 InChI Key: REQVOKPBMSCTNI-UHFFFAOYSA-L PubChem CID: 131675641 IUPAC Name: 3-diphenylphosphanylpropyl(diphenyl)phosphane;nickel;dihydrochloride SMILES: Cl[Ni++]Cl.C(CP(C1=CC=CC=C1)C1=CC=CC=C1)CP(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 131675641 |
|---|---|
| CAS | 15629-92-2 |
| Molecular Weight (g/mol) | 542.04 |
| MDL Number | MFCD00015318 |
| SMILES | Cl[Ni++]Cl.C(CP(C1=CC=CC=C1)C1=CC=CC=C1)CP(C1=CC=CC=C1)C1=CC=CC=C1 |
| IUPAC Name | 3-diphenylphosphanylpropyl(diphenyl)phosphane;nickel;dihydrochloride |
| InChI Key | REQVOKPBMSCTNI-UHFFFAOYSA-L |
| Molecular Formula | C27H26Cl2NiP2 |
Tetrakis(hydroxymethyl)phosphonium chloride, approx. 75-85% solution in water
CAS: 124-64-1 | C4H12ClO4P | 190.56 g/mol
| Boiling Point | 115.0°C |
|---|---|
| Molecular Weight (g/mol) | 190.56 |
| Color | Green-Yellow or Pink |
| Physical Form | Solution |
| Chemical Name or Material | Tetrakis(hydroxymethyl)phosphonium chloride |
| SMILES | [Cl-].OC[P+](CO)(CO)CO |
| InChI Key | AKXUUJCMWZFYMV-UHFFFAOYSA-M |
| Density | 1.3400g/mL |
| PubChem CID | 31298 |
| Percent Purity | 80.0 to 85.0% |
| CAS | 7732-18-5 |
| Infrared Spectrum | Authentic |
| Health Hazard 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective |
| MDL Number | MFCD00031687 |
| Health Hazard 2 | GHS H Statement May be corrosive to metals. Toxic if swallowed. Causes severe skin burns and eye damage. May cause an allergic skin reaction. Suspected of damaging the unborn child. Very toxic to aquatic life with lon |
| Solubility Information | Solubility in water: soluble. |
| Packaging | Glass bottle |
| Flash Point | 96°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetrakis hydroxymethyl phosphonium chloride,thpc,pyroset tkc,retardol c,tetramethylolphosphonium chloride,tetrakis hydroxymethyl phosphanium chloride,unii-58wb2xcf8i,proban cc,tetrakis hydroxymethyl phosphochloride,ccris 317 |
| IUPAC Name | tetrakis(hydroxymethyl)phosphanium;chloride |
| Molecular Formula | C4H12ClO4P |
| EINECS Number | 204-707-7 |
| Formula Weight | 190.56 |
| Specific Gravity | 1.34 |
Tri-n-butylphosphine, 95%
CAS: 998-40-3 Molecular Formula: C12H27P Molecular Weight (g/mol): 202.32 MDL Number: MFCD00009462 InChI Key: TUQOTMZNTHZOKS-UHFFFAOYSA-N Synonym: tributylphosphine,tri-n-butylphosphine,phosphine, tributyl,tris butyl phosphine,tributylfosfin,tributylfosfin czech,tributyl-phosphane,unii-0o52fjr7wn,tri-n-butyl phosphine,tributyl phosphine tbp PubChem CID: 13831 IUPAC Name: tributylphosphane SMILES: CCCCP(CCCC)CCCC
| PubChem CID | 13831 |
|---|---|
| CAS | 998-40-3 |
| Molecular Weight (g/mol) | 202.32 |
| MDL Number | MFCD00009462 |
| SMILES | CCCCP(CCCC)CCCC |
| Synonym | tributylphosphine,tri-n-butylphosphine,phosphine, tributyl,tris butyl phosphine,tributylfosfin,tributylfosfin czech,tributyl-phosphane,unii-0o52fjr7wn,tri-n-butyl phosphine,tributyl phosphine tbp |
| IUPAC Name | tributylphosphane |
| InChI Key | TUQOTMZNTHZOKS-UHFFFAOYSA-N |
| Molecular Formula | C12H27P |