Learn More
Ketotifen fumarate, 99%, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J63708.MD
| Quantity | 250mg |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
SolubilitySoluble in water (10 mg/ml), DMSO (100 mM), and methanol.
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from strong oxidizing agents.
Chemical Identifiers
| 34580-14-8 | |
| 425.499 | |
| YNQQEYBLVYAWNX-WLHGVMLRSA-N | |
| 5282408 | |
| CN1CCC(=C2C3=C(C(=O)CC4=CC=CC=C42)SC=C3)CC1.C(=CC(=O)O)C(=O)O |
| C23H23NO5S | |
| MFCD00079394 | |
| ketotifen fumarate, zaditen, ketotifen hydrogen fumarate, alaway, unii-hbd503woro, hc 20,511 fumarate, ketotifen fumarate usan:jan, ketotifen fumarate salt, hbd503woro | |
| (E)-but-2-enedioic acid;10-(1-methylpiperidin-4-ylidene)-5H-benzo[1,2]cyclohepta[3,4-b]thiophen-4-one |
Specifications
| 34580-14-8 | |
| MFCD00079394 | |
| 14,5307 | |
| Soluble in water (10mg/ml),DMSO (100 mM),and methanol. | |
| CN1CCC(=C2C3=C(C(=O)CC4=CC=CC=C42)SC=C3)CC1.C(=CC(=O)O)C(=O)O | |
| 425.499 | |
| 425.5 | |
| Ketotifen fumarate |
| C23H23NO5S | |
| 250mg | |
| ketotifen fumarate, zaditen, ketotifen hydrogen fumarate, alaway, unii-hbd503woro, hc 20,511 fumarate, ketotifen fumarate usan:jan, ketotifen fumarate salt, hbd503woro | |
| YNQQEYBLVYAWNX-WLHGVMLRSA-N | |
| (E)-but-2-enedioic acid;10-(1-methylpiperidin-4-ylidene)-5H-benzo[1,2]cyclohepta[3,4-b]thiophen-4-one | |
| 5282408 | |
| 99% |
Indem Sie auf Absenden klicken, erklären Sie sich damit einverstanden, dass Fisher Scientific sich mit Ihnen in Verbindung setzen kann, um Ihr Feedback in diesem Formular zu bearbeiten. Wir werden Ihre Informationen nicht für andere Zwecke weitergeben. Alle bereitgestellten Kontaktinformationen werden in Übereinstimmung mit unserer Datenschutzrichtlinie aufbewahrt. Datenschutzrichtlinie.