Learn More
2,6-Dichlorobenzoic Acid, 98+%, ACROS Organics™
Brand: Acros Organics 113200250
Additional Details : CAS Number : 50-30-6 Weight : 0.07500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 25g |
Chemical Identifiers
| 2, 6-Dichlorobenzoic acid | |
| 50-30-6 | |
| 100.0 | |
| 98+% | |
| Cl2C6H3CO2H |
| 98+% | |
| 98.0 | |
| ≥98% | |
| C7H4Cl2O2 | |
| MFCD00002418 |
Specifications
| 2, 6-Dichlorobenzoic acid | |
| White to beige | |
| 25g | |
| 50-30-6 | |
| 100.0 | |
| Glass bottle | |
| ≥98% | |
| C7H4Cl2O2 | |
| MFCD00002418 | |
| MRUDNSFOFOQZDA-UHFFFAOYSA-N | |
| 2,6-dichlorobenzoic acid | |
| 5758 |
| 191.01 | |
| 141.0° to 145.0°C | |
| 98+% | |
| 98.0 | |
| Authentic | |
| Fine Crystalline Powder | |
| 98+% | |
| Cl2C6H3CO2H | |
| 09, 343 | |
| C1=CC(=C(C(=C1)Cl)C(=O)O)Cl | |
| 191.007 | |
| CHEBI:48623 |
Safety and Handling
- 2,6-Dichlorobenzoic acid
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.