Filtered Search Results
Benzamide, 99%
CAS: 55-21-0 Molecular Formula: C7H7NO Molecular Weight (g/mol): 121.14 MDL Number: MFCD00007968 InChI Key: KXDAEFPNCMNJSK-UHFFFAOYSA-N Synonym: benzoic acid amide,benzoylamide,phenylcarboxyamide,phenylcarboxamide,benzenecarboxamide,amid kyseliny benzoove,amid kyseliny benzoove czech,phenyl carboxyamide,ccris 4594,benzoic acid,amide PubChem CID: 2331 ChEBI: CHEBI:28179 IUPAC Name: benzamide SMILES: C1=CC=C(C=C1)C(=O)N
| PubChem CID | 2331 |
|---|---|
| CAS | 55-21-0 |
| Molecular Weight (g/mol) | 121.14 |
| ChEBI | CHEBI:28179 |
| MDL Number | MFCD00007968 |
| SMILES | C1=CC=C(C=C1)C(=O)N |
| Synonym | benzoic acid amide,benzoylamide,phenylcarboxyamide,phenylcarboxamide,benzenecarboxamide,amid kyseliny benzoove,amid kyseliny benzoove czech,phenyl carboxyamide,ccris 4594,benzoic acid,amide |
| IUPAC Name | benzamide |
| InChI Key | KXDAEFPNCMNJSK-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO |
Diethylenetriaminepentaacetic acid, 98+%
CAS: 67-43-6 Molecular Formula: C14H23N3O10 Molecular Weight (g/mol): 393.34 InChI Key: QPCDCPDFJACHGM-UHFFFAOYSA-N Synonym: pentetic acid,diethylenetriaminepentaacetic acid,dtpa,detapac,complexon v,detarex,perma kleer,titriplex v,monaquest cai,hamp-ex acid PubChem CID: 3053 ChEBI: CHEBI:35739 IUPAC Name: 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid SMILES: C(CN(CC(=O)O)CC(=O)O)N(CCN(CC(=O)O)CC(=O)O)CC(=O)O
| PubChem CID | 3053 |
|---|---|
| CAS | 67-43-6 |
| Molecular Weight (g/mol) | 393.34 |
| ChEBI | CHEBI:35739 |
| SMILES | C(CN(CC(=O)O)CC(=O)O)N(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| Synonym | pentetic acid,diethylenetriaminepentaacetic acid,dtpa,detapac,complexon v,detarex,perma kleer,titriplex v,monaquest cai,hamp-ex acid |
| IUPAC Name | 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid |
| InChI Key | QPCDCPDFJACHGM-UHFFFAOYSA-N |
| Molecular Formula | C14H23N3O10 |
Ethylenebis(oxyethylenenitrilo)tetraacetic acid, 98%
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.34 MDL Number: MFCD00004291 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.34 |
| ChEBI | CHEBI:30740 |
| MDL Number | MFCD00004291 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |
4-Nitrophenyl phosphate, disodium salt, hexahydrate, 98+%
CAS: 333338-18-4 Molecular Formula: C6H4NNa2O6P Molecular Weight (g/mol): 263.05 MDL Number: MFCD00007319 InChI Key: VIYFPAMJCJLZKD-UHFFFAOYSA-L Synonym: pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system PubChem CID: 77949 IUPAC Name: disodium;(4-nitrophenyl) phosphate SMILES: [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1
| PubChem CID | 77949 |
|---|---|
| CAS | 333338-18-4 |
| Molecular Weight (g/mol) | 263.05 |
| MDL Number | MFCD00007319 |
| SMILES | [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
| Synonym | pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system |
| IUPAC Name | disodium;(4-nitrophenyl) phosphate |
| InChI Key | VIYFPAMJCJLZKD-UHFFFAOYSA-L |
| Molecular Formula | C6H4NNa2O6P |
Thermo Scientific Chemicals D-Calcium pantothenate, 98%
CAS: 137-08-6 Molecular Formula: C18H32CaN2O10 Molecular Weight (g/mol): 476.54 MDL Number: MFCD00002766 InChI Key: FAPWYRCQGJNNSJ-DXHDTSSINA-L Synonym: calcium pantothenate,d-pantothenic acid hemicalcium salt,d-pantothenic acid, calcium salt,pantothenic acid, calcium salt, d,r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt,beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r PubChem CID: 131847364 IUPAC Name: calcium;3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoic acid SMILES: [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O
| PubChem CID | 131847364 |
|---|---|
| CAS | 137-08-6 |
| Molecular Weight (g/mol) | 476.54 |
| MDL Number | MFCD00002766 |
| SMILES | [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O |
| Synonym | calcium pantothenate,d-pantothenic acid hemicalcium salt,d-pantothenic acid, calcium salt,pantothenic acid, calcium salt, d,r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt,beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r |
| IUPAC Name | calcium;3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoic acid |
| InChI Key | FAPWYRCQGJNNSJ-DXHDTSSINA-L |
| Molecular Formula | C18H32CaN2O10 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, disodium salt dihydrate, 99+%, for molecular biology, DNAse, RNAse and Protease free
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, 99%, pure
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
D-Gluconic acid, calcium salt, 99%
CAS: 299-28-5 Molecular Formula: C12H22CaO14 Molecular Weight (g/mol): 430.372 MDL Number: MFCD00064209 InChI Key: NEEHYRZPVYRGPP-IYEMJOQQSA-L Synonym: calcium gluconate,calcium d-gluconate,calciofon,calglucon,glucobiogen,ebucin,calcicol,calcipur,calglucol,dragocal PubChem CID: 9290 IUPAC Name: calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate SMILES: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2]
| PubChem CID | 9290 |
|---|---|
| CAS | 299-28-5 |
| Molecular Weight (g/mol) | 430.372 |
| MDL Number | MFCD00064209 |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] |
| Synonym | calcium gluconate,calcium d-gluconate,calciofon,calglucon,glucobiogen,ebucin,calcicol,calcipur,calglucol,dragocal |
| IUPAC Name | calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChI Key | NEEHYRZPVYRGPP-IYEMJOQQSA-L |
| Molecular Formula | C12H22CaO14 |
Triethyl phosphate, 99%
CAS: 78-40-0 Molecular Formula: C6H15O4P Molecular Weight (g/mol): 182.16 MDL Number: MFCD00009077 InChI Key: DQWPFSLDHJDLRL-UHFFFAOYSA-N Synonym: triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester PubChem CID: 6535 ChEBI: CHEBI:45927 IUPAC Name: triethyl phosphate SMILES: CCOP(=O)(OCC)OCC
| PubChem CID | 6535 |
|---|---|
| CAS | 78-40-0 |
| Molecular Weight (g/mol) | 182.16 |
| ChEBI | CHEBI:45927 |
| MDL Number | MFCD00009077 |
| SMILES | CCOP(=O)(OCC)OCC |
| Synonym | triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester |
| IUPAC Name | triethyl phosphate |
| InChI Key | DQWPFSLDHJDLRL-UHFFFAOYSA-N |
| Molecular Formula | C6H15O4P |
Thermo Scientific Chemicals L-Ascorbic acid sodium salt, 99%
CAS: 134-03-2 Molecular Formula: C6H7NaO6 Molecular Weight (g/mol): 198.11 MDL Number: MFCD00082340 InChI Key: IFVCRSPJFHGFCG-HXPAKLQESA-N Synonym: sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate PubChem CID: 131674100 IUPAC Name: sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide SMILES: [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O
| PubChem CID | 131674100 |
|---|---|
| CAS | 134-03-2 |
| Molecular Weight (g/mol) | 198.11 |
| MDL Number | MFCD00082340 |
| SMILES | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| Synonym | sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate |
| IUPAC Name | sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide |
| InChI Key | IFVCRSPJFHGFCG-HXPAKLQESA-N |
| Molecular Formula | C6H7NaO6 |
Phloroglucinol, 99+%, anhydrous
CAS: 108-73-6 Molecular Formula: C6H6O3 Molecular Weight (g/mol): 126.1 InChI Key: QCDYQQDYXPDABM-UHFFFAOYSA-N Synonym: phloroglucinol,1,3,5-benzenetriol,1,3,5-trihydroxybenzene,phloroglucin,phloroglucine,spasfon-lyoc,s-trihydroxybenzene,benzene-s-triol,5-hydroxyresorcinol,benzene, trihydroxy PubChem CID: 359 ChEBI: CHEBI:16204 IUPAC Name: benzene-1,3,5-triol SMILES: C1=C(C=C(C=C1O)O)O
| PubChem CID | 359 |
|---|---|
| CAS | 108-73-6 |
| Molecular Weight (g/mol) | 126.1 |
| ChEBI | CHEBI:16204 |
| SMILES | C1=C(C=C(C=C1O)O)O |
| Synonym | phloroglucinol,1,3,5-benzenetriol,1,3,5-trihydroxybenzene,phloroglucin,phloroglucine,spasfon-lyoc,s-trihydroxybenzene,benzene-s-triol,5-hydroxyresorcinol,benzene, trihydroxy |
| IUPAC Name | benzene-1,3,5-triol |
| InChI Key | QCDYQQDYXPDABM-UHFFFAOYSA-N |
| Molecular Formula | C6H6O3 |
1-Pentanesulfonic acid, sodium salt monohydrate, 98+%, HPLC grade
CAS: 207605-40-1 Molecular Formula: C5H11NaO3S·H2O Molecular Weight (g/mol): 192.22 MDL Number: MFCD00149548 InChI Key: FPQYXAFKHLSWTI-UHFFFAOYSA-M Synonym: sodium pentane-1-sulfonate hydrate,1-pentanesulfonic acid sodium salt monohydrate,sodium 1-pentanesulfonate monohydrate,potassium hydrate pentane-1-sulfonate,sodium 1-pentanesulfonate hydrate,sodium hydrate pentane-1-sulfonate,sodium pentane-1-sulfonate-water 1/1/1,1-pentane sulphonic acid sodium salt monohydrate,1-pentanesulfonic acid sodium salt monohydydrate,sodium 1-pentanesulfonate monohydrate, hplc grade PubChem CID: 23693099 IUPAC Name: sodium;pentane-1-sulfonate;hydrate SMILES: CCCCCS(=O)(=O)[O-].O.[Na+]
| PubChem CID | 23693099 |
|---|---|
| CAS | 207605-40-1 |
| Molecular Weight (g/mol) | 192.22 |
| MDL Number | MFCD00149548 |
| SMILES | CCCCCS(=O)(=O)[O-].O.[Na+] |
| Synonym | sodium pentane-1-sulfonate hydrate,1-pentanesulfonic acid sodium salt monohydrate,sodium 1-pentanesulfonate monohydrate,potassium hydrate pentane-1-sulfonate,sodium 1-pentanesulfonate hydrate,sodium hydrate pentane-1-sulfonate,sodium pentane-1-sulfonate-water 1/1/1,1-pentane sulphonic acid sodium salt monohydrate,1-pentanesulfonic acid sodium salt monohydydrate,sodium 1-pentanesulfonate monohydrate, hplc grade |
| IUPAC Name | sodium;pentane-1-sulfonate;hydrate |
| InChI Key | FPQYXAFKHLSWTI-UHFFFAOYSA-M |
| Molecular Formula | C5H11NaO3S·H2O |
Methyl benzoate, 99%
CAS: 93-58-3 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 InChI Key: QPJVMBTYPHYUOC-UHFFFAOYSA-N Synonym: methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le PubChem CID: 7150 ChEBI: CHEBI:72775 IUPAC Name: methyl benzoate SMILES: COC(=O)C1=CC=CC=C1
| PubChem CID | 7150 |
|---|---|
| CAS | 93-58-3 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:72775 |
| SMILES | COC(=O)C1=CC=CC=C1 |
| Synonym | methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le |
| IUPAC Name | methyl benzoate |
| InChI Key | QPJVMBTYPHYUOC-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |