Filtered Search Results
| CAS | 9041-08-1 |
|---|---|
| MDL Number | MFCD00081689 |
Fumaric acid, 99+%
CAS: 110-17-8 Molecular Formula: C4H4O4 Molecular Weight (g/mol): 116.07 MDL Number: MFCD00002700 InChI Key: VZCYOOQTPOCHFL-OWOJBTEDSA-N Synonym: fumaric acid,2-butenedioic acid,trans-butenedioic acid,allomaleic acid,boletic acid,lichenic acid,tumaric acid,2e-but-2-enedioic acid,butenedioic acid,trans-2-butenedioic acid PubChem CID: 444972 ChEBI: CHEBI:18012 SMILES: OC(=O)\C=C\C(O)=O
| PubChem CID | 444972 |
|---|---|
| CAS | 110-17-8 |
| Molecular Weight (g/mol) | 116.07 |
| ChEBI | CHEBI:18012 |
| MDL Number | MFCD00002700 |
| SMILES | OC(=O)\C=C\C(O)=O |
| Synonym | fumaric acid,2-butenedioic acid,trans-butenedioic acid,allomaleic acid,boletic acid,lichenic acid,tumaric acid,2e-but-2-enedioic acid,butenedioic acid,trans-2-butenedioic acid |
| InChI Key | VZCYOOQTPOCHFL-OWOJBTEDSA-N |
| Molecular Formula | C4H4O4 |
Guanidine hydrochloride, 98%
CAS: 50-01-1 Molecular Formula: CH6ClN3 Molecular Weight (g/mol): 95.53 MDL Number: MFCD00013026 InChI Key: PJJJBBJSCAKJQF-UHFFFAOYSA-N Synonym: guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride PubChem CID: 5742 ChEBI: CHEBI:32735 IUPAC Name: guanidine;hydrochloride SMILES: C(=N)(N)N.Cl
| PubChem CID | 5742 |
|---|---|
| CAS | 50-01-1 |
| Molecular Weight (g/mol) | 95.53 |
| ChEBI | CHEBI:32735 |
| MDL Number | MFCD00013026 |
| SMILES | C(=N)(N)N.Cl |
| Synonym | guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride |
| IUPAC Name | guanidine;hydrochloride |
| InChI Key | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| Molecular Formula | CH6ClN3 |
Thermo Scientific™ High-Purity Maltoside Detergents
Maltoside detergents are a class of nonionic surfactants that are commonly utilized in the field of membrane protein solubilization. Several studies have shown that these surfactants are highly effective in extracting and stabilizing membrane proteins.
D-Gluconic acid, calcium salt, 99%
CAS: 299-28-5 Molecular Formula: C12H22CaO14 Molecular Weight (g/mol): 430.372 MDL Number: MFCD00064209 InChI Key: NEEHYRZPVYRGPP-IYEMJOQQSA-L Synonym: calcium gluconate,calcium d-gluconate,calciofon,calglucon,glucobiogen,ebucin,calcicol,calcipur,calglucol,dragocal PubChem CID: 9290 IUPAC Name: calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate SMILES: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2]
| PubChem CID | 9290 |
|---|---|
| CAS | 299-28-5 |
| Molecular Weight (g/mol) | 430.372 |
| MDL Number | MFCD00064209 |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] |
| Synonym | calcium gluconate,calcium d-gluconate,calciofon,calglucon,glucobiogen,ebucin,calcicol,calcipur,calglucol,dragocal |
| IUPAC Name | calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChI Key | NEEHYRZPVYRGPP-IYEMJOQQSA-L |
| Molecular Formula | C12H22CaO14 |
Invitrogen™ BODIPY™ FL C12 (4,4-Difluoro-5,7-Dimethyl-4-Bora-3a,4a-Diaza-s-Indacene-3-Dodecanoic Acid)
The green fluorescent fatty acid, BODIPY™ FL C12 can be used as a synthetic precursor to a wide variety of fluorescent phospholipids.
Invitrogen™ Texas Red™ 1,2-Dihexadecanoyl-sn-Glycero-3-Phosphoethanolamine, Triethylammonium Salt (Texas Red™ DHPE)
The phospholipid, Texas Red™ 1,2-dihexadecanoyl-sn-glycero-3-phosphoethanolamine, triethylammonium salt (Texas Red™ DHPE) is labeled on the head group with the bright, red-fluorescent Texas Red™ dye.
Gluconic acid, sodium salt, 98%
CAS: 527-07-1 Molecular Formula: C6H11NaO7 Molecular Weight (g/mol): 218.137 MDL Number: MFCD00064210 InChI Key: UPMFZISCCZSDND-JJKGCWMISA-M Synonym: sodium gluconate,sodium d-gluconate,d-gluconic acid sodium salt,d-gluconic acid, monosodium salt,gluconic acid sodium salt,monosodium gluconate,glonsen,monosodium d-gluconate,gluconate sodium,pasexon 100t PubChem CID: 23672301 ChEBI: CHEBI:84997 IUPAC Name: sodium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate SMILES: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+]
| PubChem CID | 23672301 |
|---|---|
| CAS | 527-07-1 |
| Molecular Weight (g/mol) | 218.137 |
| ChEBI | CHEBI:84997 |
| MDL Number | MFCD00064210 |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+] |
| Synonym | sodium gluconate,sodium d-gluconate,d-gluconic acid sodium salt,d-gluconic acid, monosodium salt,gluconic acid sodium salt,monosodium gluconate,glonsen,monosodium d-gluconate,gluconate sodium,pasexon 100t |
| IUPAC Name | sodium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChI Key | UPMFZISCCZSDND-JJKGCWMISA-M |
| Molecular Formula | C6H11NaO7 |
Urea, ultrapure, 99%
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
1,4-Dithio-DL-threitol, Electrophoresis Grade, 99%
CAS: 12-3-3483 Molecular Formula: C4H10O2S2 Molecular Weight (g/mol): 154.24 MDL Number: MFCD00004877 InChI Key: VHJLVAABSRFDPM-IMJSIDKUSA-N Synonym: dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt PubChem CID: 446094 ChEBI: CHEBI:42170 IUPAC Name: (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol SMILES: C(C(C(CS)O)O)S
| PubChem CID | 446094 |
|---|---|
| CAS | 12-3-3483 |
| Molecular Weight (g/mol) | 154.24 |
| ChEBI | CHEBI:42170 |
| MDL Number | MFCD00004877 |
| SMILES | C(C(C(CS)O)O)S |
| Synonym | dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt |
| IUPAC Name | (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol |
| InChI Key | VHJLVAABSRFDPM-IMJSIDKUSA-N |
| Molecular Formula | C4H10O2S2 |
Acetylcholine Chloride, 99%
CAS: 60-31-1 Molecular Formula: C7H16ClNO2 Molecular Weight (g/mol): 181.66 MDL Number: MFCD00011698 InChI Key: JUGOREOARAHOCO-UHFFFAOYSA-M Synonym: acetylcholine chloride,miochol,acecoline,chloroacetylcholine,arterocoline,acecholin,ovisot,ach chloride,azetylcholinchlorid,2-acetyloxy-n,n,n-trimethylethanaminium chloride PubChem CID: 6060 ChEBI: CHEBI:2417 IUPAC Name: 2-acetyloxyethyl(trimethyl)azanium;chloride SMILES: CC(=O)OCC[N+](C)(C)C.[Cl-]
| PubChem CID | 6060 |
|---|---|
| CAS | 60-31-1 |
| Molecular Weight (g/mol) | 181.66 |
| ChEBI | CHEBI:2417 |
| MDL Number | MFCD00011698 |
| SMILES | CC(=O)OCC[N+](C)(C)C.[Cl-] |
| Synonym | acetylcholine chloride,miochol,acecoline,chloroacetylcholine,arterocoline,acecholin,ovisot,ach chloride,azetylcholinchlorid,2-acetyloxy-n,n,n-trimethylethanaminium chloride |
| IUPAC Name | 2-acetyloxyethyl(trimethyl)azanium;chloride |
| InChI Key | JUGOREOARAHOCO-UHFFFAOYSA-M |
| Molecular Formula | C7H16ClNO2 |
Choline Chloride, 99%
CAS: 67-48-1 Molecular Formula: C5H14ClNO Molecular Weight (g/mol): 139.62 MDL Number: MFCD00011721 InChI Key: SGMZJAMFUVOLNK-UHFFFAOYSA-M Synonym: choline chloride,hepacholine,biocolina,biocoline,lipotril,paresan,luridin chloride,choline hydrochloride,cholinium chloride,bilineurin chloride PubChem CID: 6209 ChEBI: CHEBI:133341 IUPAC Name: 2-hydroxyethyl(trimethyl)azanium;chloride SMILES: [Cl-].C[N+](C)(C)CCO
| PubChem CID | 6209 |
|---|---|
| CAS | 67-48-1 |
| Molecular Weight (g/mol) | 139.62 |
| ChEBI | CHEBI:133341 |
| MDL Number | MFCD00011721 |
| SMILES | [Cl-].C[N+](C)(C)CCO |
| Synonym | choline chloride,hepacholine,biocolina,biocoline,lipotril,paresan,luridin chloride,choline hydrochloride,cholinium chloride,bilineurin chloride |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;chloride |
| InChI Key | SGMZJAMFUVOLNK-UHFFFAOYSA-M |
| Molecular Formula | C5H14ClNO |
beta-Nicotinamide adenine dinucleotide, 97%
CAS: 53-84-9 Molecular Formula: C21H27N7O14P2 Molecular Weight (g/mol): 663.43 MDL Number: MFCD00150377 InChI Key: BAWFJGJZGIEFAR-WIWLTUSXNA-N Synonym: nicotinamide adenine dinucleotide,nad+,diphosphopyridine nucleotide,nad-oxidized,nicotinamide-adenine dinucleotide,dpn-ox,beta-nicotinamide adenine dinucleotide,dpn+,nad,nad + PubChem CID: 15938971 ChEBI: CHEBI:57540 IUPAC Name: [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate SMILES: NC(=O)C1=CC=C[N+](=C1)[C@@H]1O[C@H](COP([O-])(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O
| PubChem CID | 15938971 |
|---|---|
| CAS | 53-84-9 |
| Molecular Weight (g/mol) | 663.43 |
| ChEBI | CHEBI:57540 |
| MDL Number | MFCD00150377 |
| SMILES | NC(=O)C1=CC=C[N+](=C1)[C@@H]1O[C@H](COP([O-])(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O |
| Synonym | nicotinamide adenine dinucleotide,nad+,diphosphopyridine nucleotide,nad-oxidized,nicotinamide-adenine dinucleotide,dpn-ox,beta-nicotinamide adenine dinucleotide,dpn+,nad,nad + |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| InChI Key | BAWFJGJZGIEFAR-WIWLTUSXNA-N |
| Molecular Formula | C21H27N7O14P2 |
Invitrogen™ BODIPY™ 500/510 C1, C12 (4,4-Difluoro-5-Methyl-4-Bora-3a,4a-Diaza-s-Indacene-3-Dodecanoic Acid)
Forms excimers and exhibits red-shifted fluorescence emission when incorporated into living cells