Filtered Search Results
| Concentration or Composition (by Analyte or Components) | 3, 7-Bis(dimethylamino)phenothiazin-5-ium chloride hydrate: 1.0%; Water: 99% |
|---|---|
| CAS | 7732-18-5 |
| MDL Number | MFCD00012111 |
| Physical Form | Liquid |
| Solubility Information | Miscible with ethanol,chloroform,glacial acetic acid and glycerol. Slightly miscible with pyridine. Immiscible with ethyl ether,xylene,oleic acid,ethanol and acetone. |
| Chemical Name or Material | Methylene Blue |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Molecular Formula | C16H18ClN3S |
| Formula Weight | 319.86 |
| Vapor Pressure | 23 hPa (17mm Hg) at 20°C |
| Assay Percent Range | 1% w/v aqueous solution |
Thermo Scientific Chemicals Sudan III
CAS: 85-86-9 Molecular Formula: C22H16N4O Molecular Weight (g/mol): 352.397 MDL Number: MFCD00003905 InChI Key: HTPQPMPFXUWUOT-UHFFFAOYSA-N Synonym: C.I. 26100; Solvent Red 23 PubChem CID: 6789251 IUPAC Name: 1-[(4-phenyldiazenylphenyl)hydrazinylidene]naphthalen-2-one SMILES: C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NN=C3C(=O)C=CC4=CC=CC=C43
| PubChem CID | 6789251 |
|---|---|
| CAS | 85-86-9 |
| Molecular Weight (g/mol) | 352.397 |
| MDL Number | MFCD00003905 |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NN=C3C(=O)C=CC4=CC=CC=C43 |
| Synonym | C.I. 26100; Solvent Red 23 |
| IUPAC Name | 1-[(4-phenyldiazenylphenyl)hydrazinylidene]naphthalen-2-one |
| InChI Key | HTPQPMPFXUWUOT-UHFFFAOYSA-N |
| Molecular Formula | C22H16N4O |
Thermo Scientific Chemicals Eriochrome Black T
CAS: 1787-61-7 Molecular Formula: C20H12N3NaO7S Molecular Weight (g/mol): 461.38 MDL Number: MFCD00003935 InChI Key: JHUJLRKQZAPSDP-GXTSIBQPSA-M Synonym: C.I. 14645; Mordant Black 11 PubChem CID: 87355429 SMILES: [Na+].OC1=C2C=CC=CC2=CC=C1N\N=C1/C(=O)C=C(C2=CC(=CC=C12)[N+]([O-])=O)S([O-])(=O)=O
| PubChem CID | 87355429 |
|---|---|
| CAS | 1787-61-7 |
| Molecular Weight (g/mol) | 461.38 |
| MDL Number | MFCD00003935 |
| SMILES | [Na+].OC1=C2C=CC=CC2=CC=C1N\N=C1/C(=O)C=C(C2=CC(=CC=C12)[N+]([O-])=O)S([O-])(=O)=O |
| Synonym | C.I. 14645; Mordant Black 11 |
| InChI Key | JHUJLRKQZAPSDP-GXTSIBQPSA-M |
| Molecular Formula | C20H12N3NaO7S |
Thermo Scientific Chemicals Methyl blue
CAS: 28983-56-4 Molecular Formula: C37H26N3Na2O9S3 Molecular Weight (g/mol): 798.79 MDL Number: MFCD00058509 InChI Key: TUHAIJABPUJAEY-UHFFFAOYSA-K Synonym: Acid blue 93; C.I. 42780 PubChem CID: 76956083 SMILES: [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC=C1NC1=CC=C(C=C1)C(C1=CC=C(NC2=CC=CC=C2S([O-])(=O)=O)C=C1)=C1C=CC(C=C1)=NC1=CC=CC=C1S([O-])(=O)=O
| PubChem CID | 76956083 |
|---|---|
| CAS | 28983-56-4 |
| Molecular Weight (g/mol) | 798.79 |
| MDL Number | MFCD00058509 |
| SMILES | [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC=C1NC1=CC=C(C=C1)C(C1=CC=C(NC2=CC=CC=C2S([O-])(=O)=O)C=C1)=C1C=CC(C=C1)=NC1=CC=CC=C1S([O-])(=O)=O |
| Synonym | Acid blue 93; C.I. 42780 |
| InChI Key | TUHAIJABPUJAEY-UHFFFAOYSA-K |
| Molecular Formula | C37H26N3Na2O9S3 |
Thermo Scientific Chemicals Basic Fuchsin
CAS: 632-99-5 Molecular Formula: C20H20ClN3 Molecular Weight (g/mol): 337.85 MDL Number: MFCD00012569 InChI Key: AXDJCCTWPBKUKL-UHFFFAOYSA-N Synonym: basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic PubChem CID: 12447 IUPAC Name: 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydrochloride SMILES: [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1
| PubChem CID | 12447 |
|---|---|
| CAS | 632-99-5 |
| Molecular Weight (g/mol) | 337.85 |
| MDL Number | MFCD00012569 |
| SMILES | [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1 |
| Synonym | basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic |
| IUPAC Name | 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydrochloride |
| InChI Key | AXDJCCTWPBKUKL-UHFFFAOYSA-N |
| Molecular Formula | C20H20ClN3 |
Thermo Scientific Chemicals Indigo carmine
CAS: 860-22-0 Molecular Formula: C16H8N2Na2O8S2 Molecular Weight (g/mol): 466.35 MDL Number: MFCD00005723 InChI Key: KHLVKKOJDHCJMG-QDBORUFSSA-L Synonym: indigo carmine,indigocarmine,acid blue 74,indigocarmin,indigotindisulfonate sodium,c.i. acid blue 74,food blue no. 2,amacid brilliant blue,c.i. food blue 1,fd&c blue no. 2 PubChem CID: 5284351 SMILES: [Na+].[Na+].[O-]S(=O)(=O)C1=CC=C2N\C(C(=O)C2=C1)=C1\NC2=CC=C(C=C2C1=O)S([O-])(=O)=O
| PubChem CID | 5284351 |
|---|---|
| CAS | 860-22-0 |
| Molecular Weight (g/mol) | 466.35 |
| MDL Number | MFCD00005723 |
| SMILES | [Na+].[Na+].[O-]S(=O)(=O)C1=CC=C2N\C(C(=O)C2=C1)=C1\NC2=CC=C(C=C2C1=O)S([O-])(=O)=O |
| Synonym | indigo carmine,indigocarmine,acid blue 74,indigocarmin,indigotindisulfonate sodium,c.i. acid blue 74,food blue no. 2,amacid brilliant blue,c.i. food blue 1,fd&c blue no. 2 |
| InChI Key | KHLVKKOJDHCJMG-QDBORUFSSA-L |
| Molecular Formula | C16H8N2Na2O8S2 |
Thermo Scientific Chemicals Rose Bengal
CAS: 632-69-9 Molecular Formula: C20H4Cl4I4Na2O5 Molecular Weight (g/mol): 1019.644 MDL Number: MFCD00151169 InChI Key: DPBQSRZQYAYDGY-UHFFFAOYSA-N Synonym: rose bengal disodium salt,r105 sodium,rose bengal sodium,rose-bengal 131 i natrium,food red no. 105, sodium salt,food red color no. 105, sodium salt,rosa bengala sodica 131 i inn-spanish,rose bengale 131 i sodique inn-french,sel disodique de rose bengale iodee 131 i,roseum bengalense 131 i natricum inn-latin PubChem CID: 87244310 IUPAC Name: sodium;4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one SMILES: C1=C2C(=C(C(=C1I)O)I)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)I)O)I.[Na].[Na]
| PubChem CID | 87244310 |
|---|---|
| CAS | 632-69-9 |
| Molecular Weight (g/mol) | 1019.644 |
| MDL Number | MFCD00151169 |
| SMILES | C1=C2C(=C(C(=C1I)O)I)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)I)O)I.[Na].[Na] |
| Synonym | rose bengal disodium salt,r105 sodium,rose bengal sodium,rose-bengal 131 i natrium,food red no. 105, sodium salt,food red color no. 105, sodium salt,rosa bengala sodica 131 i inn-spanish,rose bengale 131 i sodique inn-french,sel disodique de rose bengale iodee 131 i,roseum bengalense 131 i natricum inn-latin |
| IUPAC Name | sodium;4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChI Key | DPBQSRZQYAYDGY-UHFFFAOYSA-N |
| Molecular Formula | C20H4Cl4I4Na2O5 |
Thermo Scientific Chemicals Sudan IV
CAS: 85-83-6 Molecular Formula: C24H20N4O Molecular Weight (g/mol): 380.45 MDL Number: MFCD00003893 InChI Key: KMDLOETUWUPGMB-BXCCFQQFSA-N Synonym: C.I. 26105; Scarlet Red PubChem CID: 6797604 IUPAC Name: (1Z)-1-(2-{2-methyl-4-[2-(2-methylphenyl)diazen-1-yl]phenyl}hydrazin-1-ylidene)-1,2-dihydronaphthalen-2-one SMILES: CC1=CC(=CC=C1N\N=C1/C(=O)C=CC2=CC=CC=C12)N=NC1=CC=CC=C1C
| PubChem CID | 6797604 |
|---|---|
| CAS | 85-83-6 |
| Molecular Weight (g/mol) | 380.45 |
| MDL Number | MFCD00003893 |
| SMILES | CC1=CC(=CC=C1N\N=C1/C(=O)C=CC2=CC=CC=C12)N=NC1=CC=CC=C1C |
| Synonym | C.I. 26105; Scarlet Red |
| IUPAC Name | (1Z)-1-(2-{2-methyl-4-[2-(2-methylphenyl)diazen-1-yl]phenyl}hydrazin-1-ylidene)-1,2-dihydronaphthalen-2-one |
| InChI Key | KMDLOETUWUPGMB-BXCCFQQFSA-N |
| Molecular Formula | C24H20N4O |
Thermo Scientific Chemicals Cresol Red
CAS: 1733-12-6 Molecular Formula: C21H18O5S Molecular Weight (g/mol): 382.43 MDL Number: MFCD00005878 InChI Key: OBRMNDMBJQTZHV-UHFFFAOYSA-N Synonym: o-Cresolsulfonephthalein PubChem CID: 73013 ChEBI: CHEBI:86218 IUPAC Name: 4-[3-(4-hydroxy-3-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-2-methylphenol SMILES: CC1=CC(=CC=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(C)=C1
| PubChem CID | 73013 |
|---|---|
| CAS | 1733-12-6 |
| Molecular Weight (g/mol) | 382.43 |
| ChEBI | CHEBI:86218 |
| MDL Number | MFCD00005878 |
| SMILES | CC1=CC(=CC=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(C)=C1 |
| Synonym | o-Cresolsulfonephthalein |
| IUPAC Name | 4-[3-(4-hydroxy-3-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-2-methylphenol |
| InChI Key | OBRMNDMBJQTZHV-UHFFFAOYSA-N |
| Molecular Formula | C21H18O5S |
Murexide
CAS: 3051-09-0 Molecular Formula: C8H3N5O6-2 Molecular Weight (g/mol): 265.141 MDL Number: MFCD00012777 InChI Key: MUMMBXDKKJEASE-UHFFFAOYSA-L Synonym: murexide,ammonium purpurate acid,6-oxo-5-2,4,6-trioxo-1,3-diazinan-5-ylidene amino-1h-pyrimidine-2,4-diolate,5-hexahydro-2,4,6-trioxo-5-pyrimidinyl imino-2,4,6 1h,3h,5h-pyrimidinetrione ammonium salt,6-oxidanylidene-5-2,4,6-tris oxidanylidene-1,3-diazinan-5-ylidene amino-1h-pyrimidine-2,4-diolate PubChem CID: 51381221 IUPAC Name: 6-oxo-5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]-1H-pyrimidine-2,4-diolate SMILES: C1(=C(N=C(NC1=O)[O-])[O-])N=C2C(=O)NC(=O)NC2=O
| PubChem CID | 51381221 |
|---|---|
| CAS | 3051-09-0 |
| Molecular Weight (g/mol) | 265.141 |
| MDL Number | MFCD00012777 |
| SMILES | C1(=C(N=C(NC1=O)[O-])[O-])N=C2C(=O)NC(=O)NC2=O |
| Synonym | murexide,ammonium purpurate acid,6-oxo-5-2,4,6-trioxo-1,3-diazinan-5-ylidene amino-1h-pyrimidine-2,4-diolate,5-hexahydro-2,4,6-trioxo-5-pyrimidinyl imino-2,4,6 1h,3h,5h-pyrimidinetrione ammonium salt,6-oxidanylidene-5-2,4,6-tris oxidanylidene-1,3-diazinan-5-ylidene amino-1h-pyrimidine-2,4-diolate |
| IUPAC Name | 6-oxo-5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]-1H-pyrimidine-2,4-diolate |
| InChI Key | MUMMBXDKKJEASE-UHFFFAOYSA-L |
| Molecular Formula | C8H3N5O6-2 |
Sulforhodamine B sodium salt
CAS: 3520-42-1 Molecular Formula: C29H33N2NaO7S2 Molecular Weight (g/mol): 608.70 MDL Number: MFCD00010180 InChI Key: XJENLUNLXRJLEZ-UHFFFAOYSA-M Synonym: C.I. 45100; Kiton Red S PubChem CID: 131852807 IUPAC Name: 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-sulfobenzenesulfonate;sodium SMILES: [Na+].CCN(CC)C1=CC2=[O+]C3=CC(N(CC)CC)=C(C)C=C3C(C3=CC=C(C=C3S([O-])(=O)=O)S([O-])(=O)=O)=C2C=C1C
| PubChem CID | 131852807 |
|---|---|
| CAS | 3520-42-1 |
| Molecular Weight (g/mol) | 608.70 |
| MDL Number | MFCD00010180 |
| SMILES | [Na+].CCN(CC)C1=CC2=[O+]C3=CC(N(CC)CC)=C(C)C=C3C(C3=CC=C(C=C3S([O-])(=O)=O)S([O-])(=O)=O)=C2C=C1C |
| Synonym | C.I. 45100; Kiton Red S |
| IUPAC Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-sulfobenzenesulfonate;sodium |
| InChI Key | XJENLUNLXRJLEZ-UHFFFAOYSA-M |
| Molecular Formula | C29H33N2NaO7S2 |
Thermo Scientific Chemicals Oil Red O
CAS: 1320-06-5 Molecular Formula: C26H24N4O Molecular Weight (g/mol): 408.51 MDL Number: MFCD00003898 InChI Key: HJAYEODIXUYVIC-LTFAAIOASA-N Synonym: C.I. 26125; Solvent Red 27 PubChem CID: 6046885 IUPAC Name: (1Z)-1-[[4-[(2,5-dimethylphenyl)diazenyl]-2,5-dimethylphenyl]hydrazinylidene]naphthalen-2-one SMILES: CC1=CC=C(C)C(=C1)N=NC1=CC(C)=C(N\N=C2/C(=O)C=CC3=CC=CC=C23)C=C1C
| PubChem CID | 6046885 |
|---|---|
| CAS | 1320-06-5 |
| Molecular Weight (g/mol) | 408.51 |
| MDL Number | MFCD00003898 |
| SMILES | CC1=CC=C(C)C(=C1)N=NC1=CC(C)=C(N\N=C2/C(=O)C=CC3=CC=CC=C23)C=C1C |
| Synonym | C.I. 26125; Solvent Red 27 |
| IUPAC Name | (1Z)-1-[[4-[(2,5-dimethylphenyl)diazenyl]-2,5-dimethylphenyl]hydrazinylidene]naphthalen-2-one |
| InChI Key | HJAYEODIXUYVIC-LTFAAIOASA-N |
| Molecular Formula | C26H24N4O |
Thermo Scientific Chemicals Xylenol Orange tetrasodium salt, ACS
CAS: 3618-43-7 MDL Number: MFCD00044293
| CAS | 3618-43-7 |
|---|---|
| MDL Number | MFCD00044293 |
Fluorescamine
CAS: 38183-12-9 Molecular Formula: C17H10O4 Molecular Weight (g/mol): 278.26 MDL Number: MFCD00005928 InChI Key: ZFKJVJIDPQDDFY-UHFFFAOYNA-N Synonym: fluorescamine,fluram,spiro furan-2 3h ,1' 3'h-isobenzofuran-3,3'-dione, 4-phenyl,4'-phenylspiro 2-benzofuran-3,2'-furan-1,3'-dione,4-phenylspiro furan-2 3h ,1'-phthalan-3,3'-dione,4-phenylspiro furan-2 3h-1'-3'-h-isobenzofuran-3,3'-dione,zfkjvjidpqddfy-uhfffaoysa,4'-phenylspiro 2-benzofuran-3,2'-furan-1,3'-dion PubChem CID: 37927 SMILES: O=C1OC2(OC=C(C2=O)C2=CC=CC=C2)C2=CC=CC=C12
| PubChem CID | 37927 |
|---|---|
| CAS | 38183-12-9 |
| Molecular Weight (g/mol) | 278.26 |
| MDL Number | MFCD00005928 |
| SMILES | O=C1OC2(OC=C(C2=O)C2=CC=CC=C2)C2=CC=CC=C12 |
| Synonym | fluorescamine,fluram,spiro furan-2 3h ,1' 3'h-isobenzofuran-3,3'-dione, 4-phenyl,4'-phenylspiro 2-benzofuran-3,2'-furan-1,3'-dione,4-phenylspiro furan-2 3h ,1'-phthalan-3,3'-dione,4-phenylspiro furan-2 3h-1'-3'-h-isobenzofuran-3,3'-dione,zfkjvjidpqddfy-uhfffaoysa,4'-phenylspiro 2-benzofuran-3,2'-furan-1,3'-dion |
| InChI Key | ZFKJVJIDPQDDFY-UHFFFAOYNA-N |
| Molecular Formula | C17H10O4 |
Bromothymol Blue sodium salt, 0.04% w/v aq. soln.
CAS: 34722-90-2 Molecular Formula: C27H27Br2NaO5S Molecular Weight (g/mol): 646.37 MDL Number: MFCD00077263,MFCD00077263,MFCD00077263 InChI Key: NMKFVGALBGZKGW-FKWCIMQXSA-M PubChem CID: 102183223 SMILES: [Na+].CC(C)C1=CC(\C(C2=CC=CC=C2S([O-])(=O)=O)=C2/C=C(C(C)C)C(=O)C(Br)=C2C)=C(C)C(Br)=C1O
| PubChem CID | 102183223 |
|---|---|
| CAS | 34722-90-2 |
| Molecular Weight (g/mol) | 646.37 |
| MDL Number | MFCD00077263,MFCD00077263,MFCD00077263 |
| SMILES | [Na+].CC(C)C1=CC(\C(C2=CC=CC=C2S([O-])(=O)=O)=C2/C=C(C(C)C)C(=O)C(Br)=C2C)=C(C)C(Br)=C1O |
| InChI Key | NMKFVGALBGZKGW-FKWCIMQXSA-M |
| Molecular Formula | C27H27Br2NaO5S |