Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Vitamin B12, 98+% (dry wt basis)
CAS: 68-19-9 Molecular Formula: C63H89CoN14O14P Molecular Weight (g/mol): 1356.396 MDL Number: MFCD00151092 InChI Key: AGVAZMGAQJOSFJ-WZHZPDAFSA-M Synonym: vitamin b12 PubChem CID: 129893524 IUPAC Name: cobalt(2+);[(2R,3S,4R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [(2R)-1-[3-[(1R,2R,3R,5Z,7S,10Z,12S,13S,15Z,17S,18S,19R)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl- SMILES: CC1=CC2=C(C=C1C)N(C=N2)C3C(C(C(O3)CO)OP(=O)(O)OC(C)CNC(=O)CCC4(C(C5C6(C(C(C(=C(C7=NC(=CC8=NC(=C(C4=N5)C)C(C8(C)C)CCC(=O)N)C(C7(C)CC(=O)N)CCC(=O)N)C)[N-]6)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O.[C-]#N.[Co+2]
| PubChem CID | 129893524 |
|---|---|
| CAS | 68-19-9 |
| Molecular Weight (g/mol) | 1356.396 |
| MDL Number | MFCD00151092 |
| SMILES | CC1=CC2=C(C=C1C)N(C=N2)C3C(C(C(O3)CO)OP(=O)(O)OC(C)CNC(=O)CCC4(C(C5C6(C(C(C(=C(C7=NC(=CC8=NC(=C(C4=N5)C)C(C8(C)C)CCC(=O)N)C(C7(C)CC(=O)N)CCC(=O)N)C)[N-]6)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O.[C-]#N.[Co+2] |
| Synonym | vitamin b12 |
| IUPAC Name | cobalt(2+);[(2R,3S,4R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [(2R)-1-[3-[(1R,2R,3R,5Z,7S,10Z,12S,13S,15Z,17S,18S,19R)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl- |
| InChI Key | AGVAZMGAQJOSFJ-WZHZPDAFSA-M |
| Molecular Formula | C63H89CoN14O14P |
| CAS | 8047-15-2 |
|---|---|
| MDL Number | MFCD00081981 |
Ninhydrin, 99%
CAS: 485-47-2 Molecular Formula: C9H6O4 Molecular Weight (g/mol): 178.143 MDL Number: MFCD00003791 InChI Key: FEMOMIGRRWSMCU-UHFFFAOYSA-N Synonym: ninhydrin,ninhydrin hydrate,1,2,3-indantrione monohydrate,ninhydrine,2,2-dihydroxy-1h-indene-1,3 2h-dione,2,2-dihydroxy-1,3-indandione,triketohydrindene hydrate,1h-indene-1,3 2h-dione, 2,2-dihydroxy,1,2,3-indantrione, 2-hydrate,2,2-dihydroxyindane-1,3-dione PubChem CID: 10236 ChEBI: CHEBI:86374 IUPAC Name: 2,2-dihydroxyindene-1,3-dione SMILES: C1=CC=C2C(=C1)C(=O)C(C2=O)(O)O
| PubChem CID | 10236 |
|---|---|
| CAS | 485-47-2 |
| Molecular Weight (g/mol) | 178.143 |
| ChEBI | CHEBI:86374 |
| MDL Number | MFCD00003791 |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2=O)(O)O |
| Synonym | ninhydrin,ninhydrin hydrate,1,2,3-indantrione monohydrate,ninhydrine,2,2-dihydroxy-1h-indene-1,3 2h-dione,2,2-dihydroxy-1,3-indandione,triketohydrindene hydrate,1h-indene-1,3 2h-dione, 2,2-dihydroxy,1,2,3-indantrione, 2-hydrate,2,2-dihydroxyindane-1,3-dione |
| IUPAC Name | 2,2-dihydroxyindene-1,3-dione |
| InChI Key | FEMOMIGRRWSMCU-UHFFFAOYSA-N |
| Molecular Formula | C9H6O4 |
Triphenylphosphine, 99%
CAS: 603-35-0 Molecular Formula: C18H15P Molecular Weight (g/mol): 262.29 MDL Number: MFCD00003043 MFCD20489348 InChI Key: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC Name: triphenylphosphane SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11776 |
|---|---|
| CAS | 603-35-0 |
| Molecular Weight (g/mol) | 262.29 |
| MDL Number | MFCD00003043 MFCD20489348 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| IUPAC Name | triphenylphosphane |
| InChI Key | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Molecular Formula | C18H15P |
Urea, 99.5%, for analysis
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.06 |
| ChEBI | CHEBI:48376 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Benzyl Alcohol, 99%, Pure
CAS: 100-51-6 Molecular Formula: C7H8O Molecular Weight (g/mol): 108.14 MDL Number: MFCD00004599,MFCD03792087 InChI Key: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC Name: phenylmethanol SMILES: OCC1=CC=CC=C1
| PubChem CID | 244 |
|---|---|
| CAS | 100-51-6 |
| Molecular Weight (g/mol) | 108.14 |
| ChEBI | CHEBI:17987 |
| MDL Number | MFCD00004599,MFCD03792087 |
| SMILES | OCC1=CC=CC=C1 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| IUPAC Name | phenylmethanol |
| InChI Key | WVDDGKGOMKODPV-UHFFFAOYSA-N |
| Molecular Formula | C7H8O |
Tetrabutylammonium bromide, 99+%
CAS: 1643-19-2 Molecular Formula: C16H36BrN Molecular Weight (g/mol): 322.36 MDL Number: MFCD00011633 InChI Key: JRMUNVKIHCOMHV-UHFFFAOYSA-M Synonym: tetrabutylammonium bromide,tetra-n-butylammonium bromide,tbab,tetrabutylazanium bromide,tetrabutyl ammonium bromide,tetrabutyl-ammonium bromide,aliquat 100,tbabr,ipc-tba-br,unii-vjz168i98r PubChem CID: 74236 ChEBI: CHEBI:51993 IUPAC Name: tetrabutylazanium;bromide SMILES: CCCC[N+](CCCC)(CCCC)CCCC.[Br-]
| PubChem CID | 74236 |
|---|---|
| CAS | 1643-19-2 |
| Molecular Weight (g/mol) | 322.36 |
| ChEBI | CHEBI:51993 |
| MDL Number | MFCD00011633 |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[Br-] |
| Synonym | tetrabutylammonium bromide,tetra-n-butylammonium bromide,tbab,tetrabutylazanium bromide,tetrabutyl ammonium bromide,tetrabutyl-ammonium bromide,aliquat 100,tbabr,ipc-tba-br,unii-vjz168i98r |
| IUPAC Name | tetrabutylazanium;bromide |
| InChI Key | JRMUNVKIHCOMHV-UHFFFAOYSA-M |
| Molecular Formula | C16H36BrN |
Ammonium thiocyanate, 98+%
CAS: 1762-95-4 Molecular Formula: CH4N2S Molecular Weight (g/mol): 76.117 MDL Number: MFCD00011428 InChI Key: SOIFLUNRINLCBN-UHFFFAOYSA-N Synonym: ammonium thiocyanate,ammoniumrhodanid,thiocyanic acid, ammonium salt,ammonium isothiocyanate,ammonium rhodanate,weedazol tl,trans-aid,ammonium sulfocyanate,ammonium sulfocyanide,rhodanine, ammonium salt PubChem CID: 15666 IUPAC Name: azanium;thiocyanate SMILES: C(#N)[S-].[NH4+]
| PubChem CID | 15666 |
|---|---|
| CAS | 1762-95-4 |
| Molecular Weight (g/mol) | 76.117 |
| MDL Number | MFCD00011428 |
| SMILES | C(#N)[S-].[NH4+] |
| Synonym | ammonium thiocyanate,ammoniumrhodanid,thiocyanic acid, ammonium salt,ammonium isothiocyanate,ammonium rhodanate,weedazol tl,trans-aid,ammonium sulfocyanate,ammonium sulfocyanide,rhodanine, ammonium salt |
| IUPAC Name | azanium;thiocyanate |
| InChI Key | SOIFLUNRINLCBN-UHFFFAOYSA-N |
| Molecular Formula | CH4N2S |
DimethylFormamide, Certified AR for Analysis, Fisher Chemical™
CAS: 68-12-2 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.10 MDL Number: MFCD00003284 InChI Key: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC Name: N,N-dimethylformamide SMILES: CN(C)C=O
| PubChem CID | 6228 |
|---|---|
| CAS | 68-12-2 |
| Molecular Weight (g/mol) | 73.10 |
| ChEBI | CHEBI:17741 |
| MDL Number | MFCD00003284 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| IUPAC Name | N,N-dimethylformamide |
| InChI Key | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
Ethylenediaminetetraacetic Acid Disodium Salt Solution 0.1M (0.2N), NIST Standard Solution ready to use, for volumetric analysis, meets analytical specification of Ph.Eur., BP , Fisher Chemical™
CAS: 139-33-3 Molecular Formula: C10H14N2Na2O8 Molecular Weight (g/mol): 336.21 MDL Number: MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 InChI Key: ZGTMUACCHSMWAC-UHFFFAOYSA-L Synonym: ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid PubChem CID: 57339238 ChEBI: CHEBI:64734 SMILES: [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 57339238 |
|---|---|
| CAS | 139-33-3 |
| Molecular Weight (g/mol) | 336.21 |
| ChEBI | CHEBI:64734 |
| MDL Number | MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 |
| SMILES | [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid |
| InChI Key | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
| Molecular Formula | C10H14N2Na2O8 |
Urea, Certified AR for Analysis, Fisher Chemical™
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 MDL Number: 8022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| MDL Number | 8022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Polysorbate 20
CAS: 9005-64-5 Molecular Formula: (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 Molecular Weight (g/mol): 522.68 MDL Number: MFCD00165986 InChI Key: HMFKFHLTUCJZJO-UHFFFAOYNA-N Synonym: tween 20,polysorbate 20,polyoxyethylene sorbitan monolaurate,polyoxyethylene 20 sorbitan monolaurate,polysorbate inn,2-2-3,4-bis 2-hydroxyethoxy oxolan-2-yl-2-2-hydroxyethoxy ethoxy ethyl dodecanoate,alkest tw 20,polysorbate 20 nf,polysorbate 40 nf PubChem CID: 443314 IUPAC Name: 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]ethyl dodecanoate SMILES: CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO
| PubChem CID | 443314 |
|---|---|
| CAS | 9005-64-5 |
| Molecular Weight (g/mol) | 522.68 |
| MDL Number | MFCD00165986 |
| SMILES | CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO |
| Synonym | tween 20,polysorbate 20,polyoxyethylene sorbitan monolaurate,polyoxyethylene 20 sorbitan monolaurate,polysorbate inn,2-2-3,4-bis 2-hydroxyethoxy oxolan-2-yl-2-2-hydroxyethoxy ethoxy ethyl dodecanoate,alkest tw 20,polysorbate 20 nf,polysorbate 40 nf |
| IUPAC Name | 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]ethyl dodecanoate |
| InChI Key | HMFKFHLTUCJZJO-UHFFFAOYNA-N |
| Molecular Formula | (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 |
(R)-(+)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine
CAS: 442905-33-1 Molecular Formula: C46H50N2O4P2 Molecular Weight (g/mol): 756.864 MDL Number: MFCD04974235 InChI Key: JRTHAKOHBMETRC-UHFFFAOYSA-N Synonym: unii-1a4eo1493y,unii-n2pcw56063,r-4,4'-bis bis 3,5-dimethylphenyl phosphino-2,2',6,6'-tetramethoxy-3,3'-bipyridine,s---2,2',6,6'-tetramethoxy-4,4'-bis di 3,5-xylyl phosphino-3,3'-bipyridine,s-4,4'-bis bis 3,5-dimethylphenyl phosphino-2,2',6,6'-tetramethoxy-3,3'-bipyridine,xyl-p-phos, r,xyl-p-phos, s,r-xyl-p-phos mi,s-xyl-p-phos mi,xyl-p-phos PubChem CID: 11182279 IUPAC Name: [3-[4-bis(3,5-dimethylphenyl)phosphanyl-2,6-dimethoxypyridin-3-yl]-2,6-dimethoxypyridin-4-yl]-bis(3,5-dimethylphenyl)phosphane SMILES: CC1=CC(=CC(=C1)P(C2=CC(=CC(=C2)C)C)C3=CC(=NC(=C3C4=C(N=C(C=C4P(C5=CC(=CC(=C5)C)C)C6=CC(=CC(=C6)C)C)OC)OC)OC)OC)C
| PubChem CID | 11182279 |
|---|---|
| CAS | 442905-33-1 |
| Molecular Weight (g/mol) | 756.864 |
| MDL Number | MFCD04974235 |
| SMILES | CC1=CC(=CC(=C1)P(C2=CC(=CC(=C2)C)C)C3=CC(=NC(=C3C4=C(N=C(C=C4P(C5=CC(=CC(=C5)C)C)C6=CC(=CC(=C6)C)C)OC)OC)OC)OC)C |
| Synonym | unii-1a4eo1493y,unii-n2pcw56063,r-4,4'-bis bis 3,5-dimethylphenyl phosphino-2,2',6,6'-tetramethoxy-3,3'-bipyridine,s---2,2',6,6'-tetramethoxy-4,4'-bis di 3,5-xylyl phosphino-3,3'-bipyridine,s-4,4'-bis bis 3,5-dimethylphenyl phosphino-2,2',6,6'-tetramethoxy-3,3'-bipyridine,xyl-p-phos, r,xyl-p-phos, s,r-xyl-p-phos mi,s-xyl-p-phos mi,xyl-p-phos |
| IUPAC Name | [3-[4-bis(3,5-dimethylphenyl)phosphanyl-2,6-dimethoxypyridin-3-yl]-2,6-dimethoxypyridin-4-yl]-bis(3,5-dimethylphenyl)phosphane |
| InChI Key | JRTHAKOHBMETRC-UHFFFAOYSA-N |
| Molecular Formula | C46H50N2O4P2 |
(S)-(-)-2,2',6,6'-Tetramethoxy-4,4'-bis(di(3,5-xylyl)phosphino)-3,3'-bipyridine
CAS: 443347-10-2 Molecular Formula: C46H50N2O4P2 Molecular Weight (g/mol): 756.864 MDL Number: MFCD04974235 InChI Key: JRTHAKOHBMETRC-UHFFFAOYSA-N Synonym: unii-1a4eo1493y,unii-n2pcw56063,r-4,4'-bis bis 3,5-dimethylphenyl phosphino-2,2',6,6'-tetramethoxy-3,3'-bipyridine,s---2,2',6,6'-tetramethoxy-4,4'-bis di 3,5-xylyl phosphino-3,3'-bipyridine,s-4,4'-bis bis 3,5-dimethylphenyl phosphino-2,2',6,6'-tetramethoxy-3,3'-bipyridine,xyl-p-phos, r,xyl-p-phos, s,r-xyl-p-phos mi,s-xyl-p-phos mi,xyl-p-phos PubChem CID: 11182279 IUPAC Name: [3-[4-bis(3,5-dimethylphenyl)phosphanyl-2,6-dimethoxypyridin-3-yl]-2,6-dimethoxypyridin-4-yl]-bis(3,5-dimethylphenyl)phosphane SMILES: CC1=CC(=CC(=C1)P(C2=CC(=CC(=C2)C)C)C3=CC(=NC(=C3C4=C(N=C(C=C4P(C5=CC(=CC(=C5)C)C)C6=CC(=CC(=C6)C)C)OC)OC)OC)OC)C
| PubChem CID | 11182279 |
|---|---|
| CAS | 443347-10-2 |
| Molecular Weight (g/mol) | 756.864 |
| MDL Number | MFCD04974235 |
| SMILES | CC1=CC(=CC(=C1)P(C2=CC(=CC(=C2)C)C)C3=CC(=NC(=C3C4=C(N=C(C=C4P(C5=CC(=CC(=C5)C)C)C6=CC(=CC(=C6)C)C)OC)OC)OC)OC)C |
| Synonym | unii-1a4eo1493y,unii-n2pcw56063,r-4,4'-bis bis 3,5-dimethylphenyl phosphino-2,2',6,6'-tetramethoxy-3,3'-bipyridine,s---2,2',6,6'-tetramethoxy-4,4'-bis di 3,5-xylyl phosphino-3,3'-bipyridine,s-4,4'-bis bis 3,5-dimethylphenyl phosphino-2,2',6,6'-tetramethoxy-3,3'-bipyridine,xyl-p-phos, r,xyl-p-phos, s,r-xyl-p-phos mi,s-xyl-p-phos mi,xyl-p-phos |
| IUPAC Name | [3-[4-bis(3,5-dimethylphenyl)phosphanyl-2,6-dimethoxypyridin-3-yl]-2,6-dimethoxypyridin-4-yl]-bis(3,5-dimethylphenyl)phosphane |
| InChI Key | JRTHAKOHBMETRC-UHFFFAOYSA-N |
| Molecular Formula | C46H50N2O4P2 |