Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Tyloxapol, Thermo Scientific Chemicals
CAS: 25301-02-4 MDL Number: MFCD00149002 Synonym: Ethoxylated p-tert-octylphenol formaldehyde polymer
| CAS | 25301-02-4 |
|---|---|
| MDL Number | MFCD00149002 |
| Synonym | Ethoxylated p-tert-octylphenol formaldehyde polymer |
| Boiling Point | 152°C to 153°C |
|---|---|
| Molecular Weight (g/mol) | 284.48 |
| Color | Colorless or White to Yellow |
| Physical Form | Liquid or Powder |
| Chemical Name or Material | Methyl heptadecanoate |
| CAS | 1731-92-6 |
| Infrared Spectrum | Conforms |
| MDL Number | 00009001 |
| Packaging | Glass bottle |
| Flash Point | >110°C |
| Alpha Vector | METHYLHEPTADECANOATE |
| Synonym | Methyl margarate |
| Recommended Storage | Normal conditions |
| Shelf Life | 5 years |
| Molecular Formula | C18 H36 O2 |
| EINECS Number | 217-055-3 |
| Melting Point | 29°C to 30°C |
Diethylamine hydrochloride, 99%, Thermo Scientific Chemicals
CAS: 660-68-4 MDL Number: MFCD00012499 InChI Key: HDITUCONWLWUJR-UHFFFAOYSA-N Synonym: diethylamine hydrochloride,diethylammonium chloride,diethyl amine hydrochloride,n-ethylethanamine hydrochloride,ethanamine, n-ethyl-, hydrochloride,unii-ze9v3g1135,ethanamine, n-ethyl-, hydrochloride 1:1,diethylaminehydrochloride,diethylamine hcl,diethyl amine hcl PubChem CID: 10197650 IUPAC Name: N-ethylethanamine;hydrochloride SMILES: CCNCC.Cl
| PubChem CID | 10197650 |
|---|---|
| CAS | 660-68-4 |
| MDL Number | MFCD00012499 |
| SMILES | CCNCC.Cl |
| Synonym | diethylamine hydrochloride,diethylammonium chloride,diethyl amine hydrochloride,n-ethylethanamine hydrochloride,ethanamine, n-ethyl-, hydrochloride,unii-ze9v3g1135,ethanamine, n-ethyl-, hydrochloride 1:1,diethylaminehydrochloride,diethylamine hcl,diethyl amine hcl |
| IUPAC Name | N-ethylethanamine;hydrochloride |
| InChI Key | HDITUCONWLWUJR-UHFFFAOYSA-N |
Oleyl alcohol, tech. 80-85%, Thermo Scientific Chemicals
CAS: 143-28-2 Molecular Formula: C18H36O Molecular Weight (g/mol): 268.49 MDL Number: MFCD00002993 InChI Key: ALSTYHKOOCGGFT-KTKRTIGZSA-N Synonym: oleyl alcohol,cis-9-octadecen-1-ol,z-octadec-9-en-1-ol,ocenol,conditioner 1,dermaffine,lancol,novol,oceol,oleol PubChem CID: 5284499 ChEBI: CHEBI:73504 IUPAC Name: (9Z)-octadec-9-en-1-ol SMILES: CCCCCCCC\C=C/CCCCCCCCO
| PubChem CID | 5284499 |
|---|---|
| CAS | 143-28-2 |
| Molecular Weight (g/mol) | 268.49 |
| ChEBI | CHEBI:73504 |
| MDL Number | MFCD00002993 |
| SMILES | CCCCCCCC\C=C/CCCCCCCCO |
| Synonym | oleyl alcohol,cis-9-octadecen-1-ol,z-octadec-9-en-1-ol,ocenol,conditioner 1,dermaffine,lancol,novol,oceol,oleol |
| IUPAC Name | (9Z)-octadec-9-en-1-ol |
| InChI Key | ALSTYHKOOCGGFT-KTKRTIGZSA-N |
| Molecular Formula | C18H36O |
Sodium n-hexadecyl sulfate, 99%, Thermo Scientific Chemicals
CAS: 1120-01-0 Molecular Formula: C16H33NaO3S Molecular Weight (g/mol): 328.49 MDL Number: MFCD00047766 InChI Key: PNGBYKXZVCIZRN-UHFFFAOYSA-M Synonym: sodium hexadecyl sulfate,sodium cetyl sulfate,sodium n-hexadecyl sulfate,unii-3v3y3o7biq,conco sulfate c,avitex c,avitex sf,sodium hexyldecyl sulfate,tergitol anionic 7,3v3y3o7biq PubChem CID: 23695542 IUPAC Name: sodium;hexadecyl sulfate SMILES: [Na+].CCCCCCCCCCCCCCCCS([O-])(=O)=O
| PubChem CID | 23695542 |
|---|---|
| CAS | 1120-01-0 |
| Molecular Weight (g/mol) | 328.49 |
| MDL Number | MFCD00047766 |
| SMILES | [Na+].CCCCCCCCCCCCCCCCS([O-])(=O)=O |
| Synonym | sodium hexadecyl sulfate,sodium cetyl sulfate,sodium n-hexadecyl sulfate,unii-3v3y3o7biq,conco sulfate c,avitex c,avitex sf,sodium hexyldecyl sulfate,tergitol anionic 7,3v3y3o7biq |
| IUPAC Name | sodium;hexadecyl sulfate |
| InChI Key | PNGBYKXZVCIZRN-UHFFFAOYSA-M |
| Molecular Formula | C16H33NaO3S |
Deoxycholic acid, 99%, Thermo Scientific Chemicals
CAS: 83-44-3 Molecular Formula: C24H40O4 Molecular Weight (g/mol): 392.58 MDL Number: MFCD00003673 InChI Key: KXGVEGMKQFWNSR-LLQZFEROSA-N Synonym: deoxycholic acid,deoxycholate,desoxycholic acid,choleic acid,cholerebic,cholorebic,degalol,deoxycholatic acid,droxolan,pyrochol PubChem CID: 222528 ChEBI: CHEBI:28834 IUPAC Name: (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid SMILES: [H][C@@]12CC[C@H]([C@H](C)CCC(O)=O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C
| PubChem CID | 222528 |
|---|---|
| CAS | 83-44-3 |
| Molecular Weight (g/mol) | 392.58 |
| ChEBI | CHEBI:28834 |
| MDL Number | MFCD00003673 |
| SMILES | [H][C@@]12CC[C@H]([C@H](C)CCC(O)=O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C |
| Synonym | deoxycholic acid,deoxycholate,desoxycholic acid,choleic acid,cholerebic,cholorebic,degalol,deoxycholatic acid,droxolan,pyrochol |
| IUPAC Name | (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| InChI Key | KXGVEGMKQFWNSR-LLQZFEROSA-N |
| Molecular Formula | C24H40O4 |
5-Formyl-2-furancarboxylic acid, Thermo Scientific Chemicals
CAS: 13529-17-4 Molecular Formula: C6H3O4 Molecular Weight (g/mol): 139.09 InChI Key: SHNRXUWGUKDPMA-UHFFFAOYSA-M IUPAC Name: 5-formylfuran-2-carboxylate SMILES: [O-]C(=O)C1=CC=C(O1)C=O
| CAS | 13529-17-4 |
|---|---|
| Molecular Weight (g/mol) | 139.09 |
| SMILES | [O-]C(=O)C1=CC=C(O1)C=O |
| IUPAC Name | 5-formylfuran-2-carboxylate |
| InChI Key | SHNRXUWGUKDPMA-UHFFFAOYSA-M |
| Molecular Formula | C6H3O4 |
L(+)-Arginine Hydrochloride, 98+%, Thermo Scientific Chemicals
CAS: 1119-34-2 Molecular Formula: C6H14N4O2·HCl Molecular Weight (g/mol): 210.67 MDL Number: MFCD00064550 InChI Key: KWTQSFXGGICVPE-WCCKRBBISA-N Synonym: l-arginine hydrochloride,arginine hydrochloride,l-arginine hcl,l-arginine monohydrochloride,h-arg-oh.hcl,r-gene,arginine monohydrochloride,argamine,l-arginine, monohydrochloride,unii-f7lth1e20y PubChem CID: 66250 IUPAC Name: (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride SMILES: C(CC(C(=O)O)N)CN=C(N)N.Cl
| PubChem CID | 66250 |
|---|---|
| CAS | 1119-34-2 |
| Molecular Weight (g/mol) | 210.67 |
| MDL Number | MFCD00064550 |
| SMILES | C(CC(C(=O)O)N)CN=C(N)N.Cl |
| Synonym | l-arginine hydrochloride,arginine hydrochloride,l-arginine hcl,l-arginine monohydrochloride,h-arg-oh.hcl,r-gene,arginine monohydrochloride,argamine,l-arginine, monohydrochloride,unii-f7lth1e20y |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride |
| InChI Key | KWTQSFXGGICVPE-WCCKRBBISA-N |
| Molecular Formula | C6H14N4O2·HCl |
Nickel(II) trifluoromethanesulfonate, 96%, Thermo Scientific Chemicals
CAS: 60871-84-3 Molecular Formula: C2F6NiO6S2 Molecular Weight (g/mol): 356.82 MDL Number: MFCD00673740 InChI Key: KVRSDIJOUNNFMZ-UHFFFAOYSA-L Synonym: nickel ii trifluoromethanesulfonate,nickel ii triflate,nickel 2+ ditriflate,trifluoromethanesulfonic acid nickel ii salt,nickel triflate,acmc-209mmw,ni otf 2,nickelous trifluoromethanesulfonate,nickel 2+ ion ditriflate PubChem CID: 9820095 IUPAC Name: nickel(2+);trifluoromethanesulfonate SMILES: [Ni++].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F
| PubChem CID | 9820095 |
|---|---|
| CAS | 60871-84-3 |
| Molecular Weight (g/mol) | 356.82 |
| MDL Number | MFCD00673740 |
| SMILES | [Ni++].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F |
| Synonym | nickel ii trifluoromethanesulfonate,nickel ii triflate,nickel 2+ ditriflate,trifluoromethanesulfonic acid nickel ii salt,nickel triflate,acmc-209mmw,ni otf 2,nickelous trifluoromethanesulfonate,nickel 2+ ion ditriflate |
| IUPAC Name | nickel(2+);trifluoromethanesulfonate |
| InChI Key | KVRSDIJOUNNFMZ-UHFFFAOYSA-L |
| Molecular Formula | C2F6NiO6S2 |
Tri-n-butyl phosphate, 98%, Thermo Scientific Chemicals
CAS: 126-73-8 Molecular Formula: C12H27O4P Molecular Weight (g/mol): 266.32 MDL Number: MFCD00009436 InChI Key: STCOOQWBFONSKY-UHFFFAOYSA-N Synonym: tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de PubChem CID: 31357 ChEBI: CHEBI:35019 IUPAC Name: tributyl phosphate SMILES: CCCCOP(=O)(OCCCC)OCCCC
| PubChem CID | 31357 |
|---|---|
| CAS | 126-73-8 |
| Molecular Weight (g/mol) | 266.32 |
| ChEBI | CHEBI:35019 |
| MDL Number | MFCD00009436 |
| SMILES | CCCCOP(=O)(OCCCC)OCCCC |
| Synonym | tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de |
| IUPAC Name | tributyl phosphate |
| InChI Key | STCOOQWBFONSKY-UHFFFAOYSA-N |
| Molecular Formula | C12H27O4P |
Citric acid, trilithium salt tetrahydrate, 98%, pure, Thermo Scientific Chemicals
CAS: 6080-58-6 MDL Number: MFCD00150030 InChI Key: HXGWMCJZLNWEBC-UHFFFAOYSA-K Synonym: lithium citrate tetrahydrate,unii-5z6e9k79yv,trilithium citrate tetrahydrate,lithium citrate usp,citric acid trilithium salt tetrahydrate,tri-lithium citrate tetrahydrate,lithium citrate tribasic tetrahydrate,lithonate tn,1,2,3-propanetricarboxylic acid, 2-hydroxy-trilithium salt tetrahydrate PubChem CID: 2724118 ChEBI: CHEBI:64754 IUPAC Name: trilithium;2-hydroxypropane-1,2,3-tricarboxylate;tetrahydrate SMILES: [Li+].[Li+].[Li+].C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.O
| PubChem CID | 2724118 |
|---|---|
| CAS | 6080-58-6 |
| ChEBI | CHEBI:64754 |
| MDL Number | MFCD00150030 |
| SMILES | [Li+].[Li+].[Li+].C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.O |
| Synonym | lithium citrate tetrahydrate,unii-5z6e9k79yv,trilithium citrate tetrahydrate,lithium citrate usp,citric acid trilithium salt tetrahydrate,tri-lithium citrate tetrahydrate,lithium citrate tribasic tetrahydrate,lithonate tn,1,2,3-propanetricarboxylic acid, 2-hydroxy-trilithium salt tetrahydrate |
| IUPAC Name | trilithium;2-hydroxypropane-1,2,3-tricarboxylate;tetrahydrate |
| InChI Key | HXGWMCJZLNWEBC-UHFFFAOYSA-K |
Methyl 4-hydroxybenzoate, sodium salt, 99%, Thermo Scientific Chemicals
CAS: 5026-62-0 Molecular Formula: C8H7NaO3 Molecular Weight (g/mol): 174.13 MDL Number: MFCD00016470 InChI Key: PESXGULMKCKJCC-UHFFFAOYSA-M Synonym: methylparaben sodium,sodium methylparaben,sodium 4-methoxycarbonyl phenolate,preserval ms,methyl 4-hydroxybenzoate, sodium salt,solparol,bonomold omna,methyl 4-hydroxybenzoate sodium salt,sodium 4-carbomethoxyphenolate,unii-cr6k9c2nhk PubChem CID: 23663626 IUPAC Name: sodium;4-methoxycarbonylphenolate SMILES: COC(=O)C1=CC=C(C=C1)[O-].[Na+]
| PubChem CID | 23663626 |
|---|---|
| CAS | 5026-62-0 |
| Molecular Weight (g/mol) | 174.13 |
| MDL Number | MFCD00016470 |
| SMILES | COC(=O)C1=CC=C(C=C1)[O-].[Na+] |
| Synonym | methylparaben sodium,sodium methylparaben,sodium 4-methoxycarbonyl phenolate,preserval ms,methyl 4-hydroxybenzoate, sodium salt,solparol,bonomold omna,methyl 4-hydroxybenzoate sodium salt,sodium 4-carbomethoxyphenolate,unii-cr6k9c2nhk |
| IUPAC Name | sodium;4-methoxycarbonylphenolate |
| InChI Key | PESXGULMKCKJCC-UHFFFAOYSA-M |
| Molecular Formula | C8H7NaO3 |
NADPH tetrasodium salt hydrate, 93%, extra pure, Thermo Scientific Chemicals
CAS: 2646-71-1 Molecular Formula: C21H26N7Na4O17P3 Molecular Weight (g/mol): 833.35 MDL Number: MFCD10567216 InChI Key: WYWWVJHQDVCHKF-NRTBITFTNA-J Synonym: nadph tetrasodium salt,nadph, tetrasodium salt,coenzyme ii tetrasodium salt reduced form PubChem CID: 131673986 IUPAC Name: [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;molecular hydrogen;sodium SMILES: [Na+].[Na+].[Na+].[Na+].NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](OP([O-])([O-])=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O
| PubChem CID | 131673986 |
|---|---|
| CAS | 2646-71-1 |
| Molecular Weight (g/mol) | 833.35 |
| MDL Number | MFCD10567216 |
| SMILES | [Na+].[Na+].[Na+].[Na+].NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](OP([O-])([O-])=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O |
| Synonym | nadph tetrasodium salt,nadph, tetrasodium salt,coenzyme ii tetrasodium salt reduced form |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;molecular hydrogen;sodium |
| InChI Key | WYWWVJHQDVCHKF-NRTBITFTNA-J |
| Molecular Formula | C21H26N7Na4O17P3 |