Learn More
Sotalol hydrochloride, 98%, Thermo Scientific™
Potent beta adrenergic antagonist
Marque: Thermo Scientific Alfa Aesar J63772.03
| Quantity | 1g |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsSotalol hydrochloride is used as a potent beta adrenergic antagonist, prolongs the action potential and increases the refractory period. Sotalol hydrochloride is also considered a non-selective β blocker and a potassium channel blocker with an IC50 of 43 µM.
Solubility
Soluble in phosphate buffered saline, DMSO, ethanol, water, and methanol.
Notes
Keep container tightly closed. Store in cool, dry conditions in well sealed containers.
Identifiants chimiques
| 959-24-0 | |
| 308.82 | |
| VIDRYROWYFWGSY-UHFFFAOYNA-N | |
| 66245 | |
| hydrogen N-(4-{1-hydroxy-2-[(propan-2-yl)amino]ethyl}phenyl)methanesulfonamide chloride |
| C12H21ClN2O3S | |
| MFCD00242937 | |
| sotalol hydrochloride, sotalol hcl, betapace, betapace af, sotacor, sotalex, berlex, mead johnson 1999, sorine | |
| CHEBI:9207 | |
| [H+].[Cl-].CC(C)NCC(O)C1=CC=C(NS(C)(=O)=O)C=C1 |
Spécification
| 959-24-0 | |
| MFCD00242937 | |
| 14,8728 | |
| Soluble in phosphate buffered saline,DMSO,ethanol,water,and methanol. | |
| [H+].[Cl-].CC(C)NCC(O)C1=CC=C(NS(C)(=O)=O)C=C1 | |
| 308.82 | |
| CHEBI:9207 | |
| 98% |
| C12H21ClN2O3S | |
| 1g | |
| sotalol hydrochloride, sotalol hcl, betapace, betapace af, sotacor, sotalex, berlex, mead johnson 1999, sorine | |
| VIDRYROWYFWGSY-UHFFFAOYNA-N | |
| hydrogen N-(4-{1-hydroxy-2-[(propan-2-yl)amino]ethyl}phenyl)methanesulfonamide chloride | |
| 66245 | |
| 308.82 | |
| Sotalol hydrochloride |
Veuillez fournir vos retours sur le contenu du produit en remplissant le formulaire ci-dessous.