226.59 EUR valid until 2025-12-31
Use promo code "25339" to get your promotional price.
Use promo code "25339" to get your promotional price.
| Quantity | 10 g |
|---|---|
| Packaging | Glass bottle |
| CAS | 10510-54-0 |
|---|---|
| Molecular Formula | C18H15N3O3 |
| Molecular Weight (g/mol) | 321.34 |
| MDL Number | MFCD00013151,MFCD00013151 |
| InChI Key | XKOCOMKJPWEOHX-UHFFFAOYSA-M |
| PubChem CID | 44134641 |
| SMILES | CC([O-])=O.NC1=CC2=[O+]C3=C(N=C2C=C1)C1=CC=CC=C1C(N)=C3 |
| Chemical Name or Material | Cresyl Violet acetate |
|---|---|
| Melting Point | 140.0°C to 143.0°C |
| CAS | 10510-54-0 |
| Absorption Ratio | 0.94 to 1.2 |
| Dye Content | 65% min. |
| Molecular Formula | C18H15N3O3 |
| MDL Number | MFCD00013151,MFCD00013151 |
| Solubility Information | Solubility in water: soluble in water. Other solubilities: soluble in ethanol, insoluble in aceton |
| InChI Key | XKOCOMKJPWEOHX-UHFFFAOYSA-M |
| Infrared Spectrum | Authentic |
| SMILES | CC([O-])=O.NC1=CC2=[O+]C3=C(N=C2C=C1)C1=CC=CC=C1C(N)=C3 |
| IUPAC Name | acetic acid;5-iminobenzo[a]phenoxazin-9-amine |
| Molecular Weight (g/mol) | 321.34 |
| PubChem CID | 44134641 |
| Lambda Max | 596 to 599nm |
| Formula Weight | 321.34 |
| Grade | Pure |
| Packaging | Glass bottle |
| Color | Black to Green |
| Quantity | 10 g |
| Physical Form | Fine Crystalline Powder |