Filtered Search Results
Copper(II) acetylacetonate, 98%
CAS: 13395-16-9 Molecular Formula: C10H14CuO4 Molecular Weight (g/mol): 261.76 MDL Number: MFCD00000016 InChI Key: QYJPSWYYEKYVEJ-FDGPNNRMSA-L Synonym: 2, 4-Pentanedione, metal derivative,Cupric acetylacetonate IUPAC Name: copper(2+) bis((2Z)-4-oxopent-2-en-2-olate) SMILES: [Cu++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| CAS | 13395-16-9 |
|---|---|
| Molecular Weight (g/mol) | 261.76 |
| MDL Number | MFCD00000016 |
| SMILES | [Cu++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | 2, 4-Pentanedione, metal derivative,Cupric acetylacetonate |
| IUPAC Name | copper(2+) bis((2Z)-4-oxopent-2-en-2-olate) |
| InChI Key | QYJPSWYYEKYVEJ-FDGPNNRMSA-L |
| Molecular Formula | C10H14CuO4 |
Hexamethyldisiloxane, 98+%
CAS: 107-46-0 InChI Key: UQEAIHBTYFGYIE-UHFFFAOYSA-N Synonym: hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide PubChem CID: 24764 ChEBI: CHEBI:78002 IUPAC Name: trimethyl(trimethylsilyloxy)silane SMILES: C[Si](C)(C)O[Si](C)(C)C
| PubChem CID | 24764 |
|---|---|
| CAS | 107-46-0 |
| ChEBI | CHEBI:78002 |
| SMILES | C[Si](C)(C)O[Si](C)(C)C |
| Synonym | hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide |
| IUPAC Name | trimethyl(trimethylsilyloxy)silane |
| InChI Key | UQEAIHBTYFGYIE-UHFFFAOYSA-N |
Chlorotrimethylsilane, 98%
CAS: 75-77-4 Molecular Formula: C3H9ClSi Molecular Weight (g/mol): 108.64 MDL Number: MFCD00000502 InChI Key: IJOOHPMOJXWVHK-UHFFFAOYSA-N Synonym: trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl PubChem CID: 6397 ChEBI: CHEBI:85069 IUPAC Name: chloro(trimethyl)silane SMILES: C[Si](C)(C)Cl
| PubChem CID | 6397 |
|---|---|
| CAS | 75-77-4 |
| Molecular Weight (g/mol) | 108.64 |
| ChEBI | CHEBI:85069 |
| MDL Number | MFCD00000502 |
| SMILES | C[Si](C)(C)Cl |
| Synonym | trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl |
| IUPAC Name | chloro(trimethyl)silane |
| InChI Key | IJOOHPMOJXWVHK-UHFFFAOYSA-N |
| Molecular Formula | C3H9ClSi |
| Linear Formula | NaB(C2H5)3H |
|---|---|
| Molecular Weight (g/mol) | 121.99 |
| Color | Colorless |
| Physical Form | Solution |
| Chemical Name or Material | Sodium triethylborohydride |
| SMILES | [Na+].CC[BH-](CC)CC |
| InChI Key | YDTZLEUIYNMRLQ-UHFFFAOYSA-N |
| Density | 0.8900g/mL |
| PubChem CID | 23667700 |
| Name Note | 1M solution in THF |
| CAS | 109-99-9 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture |
| MDL Number | MFCD00011704 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. May cause respiratory irritation. In contact with water releases flammable gas. Highly flammable liquid and vapor. May form explosive peroxides. Reacts violentl |
| Solubility Information | Solubility in water: rzacts. |
| Packaging | AcroSeal™ Glass bottle |
| Flash Point | −17°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | sodium triethylborohydride,sodium triethylborate,sodium triethylhydroborate,sodium triethylhydridoborate,sodium triethylhydroborate 1-,sodium triethylborohydride solution,sodium triethyl-? 2-boranuide,sodiumtriethylborohydride 1m in toluene |
| IUPAC Name | sodium;triethylboron(1-) |
| Molecular Formula | C6H16BNa |
| EINECS Number | 241-903-1 |
| Formula Weight | 121.99 |
| Specific Gravity | 0.89 |
Hexamethyldisilazane, 98+%
CAS: 999-97-3 Molecular Formula: C6H19NSi2 Molecular Weight (g/mol): 161.395 MDL Number: MFCD00008259 InChI Key: FFUAGWLWBBFQJT-UHFFFAOYSA-N Synonym: hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl PubChem CID: 13838 ChEBI: CHEBI:85068 IUPAC Name: [dimethyl-(trimethylsilylamino)silyl]methane SMILES: C[Si](C)(C)N[Si](C)(C)C
| PubChem CID | 13838 |
|---|---|
| CAS | 999-97-3 |
| Molecular Weight (g/mol) | 161.395 |
| ChEBI | CHEBI:85068 |
| MDL Number | MFCD00008259 |
| SMILES | C[Si](C)(C)N[Si](C)(C)C |
| Synonym | hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl |
| IUPAC Name | [dimethyl-(trimethylsilylamino)silyl]methane |
| InChI Key | FFUAGWLWBBFQJT-UHFFFAOYSA-N |
| Molecular Formula | C6H19NSi2 |
Tetraethoxysilane, 99+%
CAS: 78-10-4 Molecular Formula: C8H20O4Si Molecular Weight (g/mol): 208.329 MDL Number: MFCD00009062 InChI Key: BOTDANWDWHJENH-UHFFFAOYSA-N Synonym: tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate PubChem CID: 6517 IUPAC Name: tetraethyl silicate SMILES: CCO[Si](OCC)(OCC)OCC
| PubChem CID | 6517 |
|---|---|
| CAS | 78-10-4 |
| Molecular Weight (g/mol) | 208.329 |
| MDL Number | MFCD00009062 |
| SMILES | CCO[Si](OCC)(OCC)OCC |
| Synonym | tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate |
| IUPAC Name | tetraethyl silicate |
| InChI Key | BOTDANWDWHJENH-UHFFFAOYSA-N |
| Molecular Formula | C8H20O4Si |
Lead(IV) acetate, 96% (dry wt.), stab. with 5-10% glacial acetic acid
CAS: 546-67-8 Molecular Formula: C8H16O8Pb Molecular Weight (g/mol): 447.408 MDL Number: MFCD00008693 InChI Key: NVTAREBLATURGT-UHFFFAOYSA-N Synonym: lead iv acetate PubChem CID: 50931538 IUPAC Name: acetic acid;lead SMILES: CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.[Pb]
| PubChem CID | 50931538 |
|---|---|
| CAS | 546-67-8 |
| Molecular Weight (g/mol) | 447.408 |
| MDL Number | MFCD00008693 |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.[Pb] |
| Synonym | lead iv acetate |
| IUPAC Name | acetic acid;lead |
| InChI Key | NVTAREBLATURGT-UHFFFAOYSA-N |
| Molecular Formula | C8H16O8Pb |
Diisobutylaluminium hydride, 1.2M (20 wt%) solution in toluene, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Boiling Point | 110.0°C |
|---|---|
| Linear Formula | [(CH3)2CHCH2]2AIH |
| Molecular Weight (g/mol) | 142.22 |
| Physical Form | Solution |
| Chemical Name or Material | Diisobutylaluminium hydride |
| Merck Index | 15, 3212 |
| Density | 0.8480g/mL |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 108-88-3 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00008928 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. May be fatal if swallowed and enters airways. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. May cause dro |
| Solubility Information | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Molecular Formula | C8H19Al |
| EINECS Number | 214-729-9 |
| Formula Weight | 142.22 |
| Specific Gravity | 0.848 |
N,O-Bis(trimethylsilyl)trifluoroacetamide, 98+%
CAS: 25561-30-2 Molecular Formula: C8H18F3NOSi2 Molecular Weight (g/mol): 257.39 MDL Number: MFCD00008269 InChI Key: XCOBLONWWXQEBS-GHXNOFRVSA-N Synonym: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896 IUPAC Name: trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate SMILES: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| PubChem CID | 9601896 |
|---|---|
| CAS | 25561-30-2 |
| Molecular Weight (g/mol) | 257.39 |
| MDL Number | MFCD00008269 |
| SMILES | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| Synonym | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| IUPAC Name | trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate |
| InChI Key | XCOBLONWWXQEBS-GHXNOFRVSA-N |
| Molecular Formula | C8H18F3NOSi2 |
3-(Trimethoxysilyl)propyl methacrylate, 98%
CAS: 2530-85-0 Molecular Formula: C10H20O5Si Molecular Weight (g/mol): 248.35 MDL Number: MFCD00008593 InChI Key: XDLMVUHYZWKMMD-UHFFFAOYSA-N Synonym: 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester PubChem CID: 17318 IUPAC Name: 3-trimethoxysilylpropyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCC[Si](OC)(OC)OC
| PubChem CID | 17318 |
|---|---|
| CAS | 2530-85-0 |
| Molecular Weight (g/mol) | 248.35 |
| MDL Number | MFCD00008593 |
| SMILES | CC(=C)C(=O)OCCC[Si](OC)(OC)OC |
| Synonym | 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester |
| IUPAC Name | 3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| InChI Key | XDLMVUHYZWKMMD-UHFFFAOYSA-N |
| Molecular Formula | C10H20O5Si |
| CAS | 4468-02-4 |
|---|---|
| MDL Number | MFCD00868110 |
Bromotrimethylsilane, 98%
CAS: 2857-97-8 Molecular Formula: C3H9BrSi Molecular Weight (g/mol): 153.1 InChI Key: IYYIVELXUANFED-UHFFFAOYSA-N Synonym: trimethylsilyl bromide,trimethylbromosilane,silane, bromotrimethyl,trimethylsilicon bromide,tmsbr,trimethylsilylbromide,bromotrimethyl silane,tmbs,bromo trimethyl silane,tms bromide PubChem CID: 76113 IUPAC Name: bromo(trimethyl)silane SMILES: C[Si](C)(C)Br
| PubChem CID | 76113 |
|---|---|
| CAS | 2857-97-8 |
| Molecular Weight (g/mol) | 153.1 |
| SMILES | C[Si](C)(C)Br |
| Synonym | trimethylsilyl bromide,trimethylbromosilane,silane, bromotrimethyl,trimethylsilicon bromide,tmsbr,trimethylsilylbromide,bromotrimethyl silane,tmbs,bromo trimethyl silane,tms bromide |
| IUPAC Name | bromo(trimethyl)silane |
| InChI Key | IYYIVELXUANFED-UHFFFAOYSA-N |
| Molecular Formula | C3H9BrSi |
Dichlorodimethylsilane, 99+%
CAS: 75-78-5 Molecular Formula: C2H6Cl2Si Molecular Weight (g/mol): 129.06 InChI Key: LIKFHECYJZWXFJ-UHFFFAOYSA-N Synonym: dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane PubChem CID: 6398 IUPAC Name: dichloro(dimethyl)silane SMILES: C[Si](C)(Cl)Cl
| PubChem CID | 6398 |
|---|---|
| CAS | 75-78-5 |
| Molecular Weight (g/mol) | 129.06 |
| SMILES | C[Si](C)(Cl)Cl |
| Synonym | dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane |
| IUPAC Name | dichloro(dimethyl)silane |
| InChI Key | LIKFHECYJZWXFJ-UHFFFAOYSA-N |
| Molecular Formula | C2H6Cl2Si |