Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Iodine, 0.1N (0.05M) standard solution
CAS: 7553-56-2 Molecular Formula: I2 Molecular Weight (g/mol): 253.81 MDL Number: MFCD00011355 MFCD00164163 InChI Key: PNDPGZBMCMUPRI-UHFFFAOYSA-N Synonym: iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode PubChem CID: 807 ChEBI: CHEBI:17606 IUPAC Name: diiodine SMILES: II
| PubChem CID | 807 |
|---|---|
| CAS | 7553-56-2 |
| Molecular Weight (g/mol) | 253.81 |
| ChEBI | CHEBI:17606 |
| MDL Number | MFCD00011355 MFCD00164163 |
| SMILES | II |
| Synonym | iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode |
| IUPAC Name | diiodine |
| InChI Key | PNDPGZBMCMUPRI-UHFFFAOYSA-N |
| Molecular Formula | I2 |
| Linear Formula | Na2S2O3 |
|---|---|
| Molecular Weight (g/mol) | 158.10 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Sodium thiosulfate |
| SMILES | [Na+].[Na+].[O-]S([S-])(=O)=O |
| Merck Index | 15, 8821 |
| InChI Key | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| PubChem CID | 24477 |
| Concentration or Composition (by Analyte or Components) | 0.0950 to 0.1050N (20°C) |
| CAS | 7732-18-5 |
| MDL Number | MFCD00003499 |
| Health Hazard 1 | |
| Synonym | sodium thiosulfate,sodium thiosulphate,disodium thiosulfate,sodium thiosulfate anhydrous,hypo,sodiumthiosulfate,chlorine cure,chlorine control,declor-it,thiosulfuric acid, disodium salt |
| Molecular Formula | Na2O3S2 |
| Formula Weight | 158.11 |
Potassium thiocyanate, 0.1N Standardized Solution
CAS: 333-20-0 Molecular Formula: CKNS Molecular Weight (g/mol): 97.176 MDL Number: MFCD00011413 InChI Key: ZNNZYHKDIALBAK-UHFFFAOYSA-M Synonym: potassium thiocyanate,potassium rhodanate,potassium rhodanide,rodanca,potassium sulfocyanate,rhodanide,rhocya,potassium thiocyanide,kscn,thiocyanic acid, potassium salt PubChem CID: 516872 ChEBI: CHEBI:30951 IUPAC Name: potassium;thiocyanate SMILES: C(#N)[S-].[K+]
| PubChem CID | 516872 |
|---|---|
| CAS | 333-20-0 |
| Molecular Weight (g/mol) | 97.176 |
| ChEBI | CHEBI:30951 |
| MDL Number | MFCD00011413 |
| SMILES | C(#N)[S-].[K+] |
| Synonym | potassium thiocyanate,potassium rhodanate,potassium rhodanide,rodanca,potassium sulfocyanate,rhodanide,rhocya,potassium thiocyanide,kscn,thiocyanic acid, potassium salt |
| IUPAC Name | potassium;thiocyanate |
| InChI Key | ZNNZYHKDIALBAK-UHFFFAOYSA-M |
| Molecular Formula | CKNS |
Sodium carbonate, ACS primary standard, 99.95-100.05% (dried basis)
CAS: 497-19-8 Molecular Formula: CNa2O3 Molecular Weight (g/mol): 105.99 MDL Number: MFCD00003494 InChI Key: CDBYLPFSWZWCQE-UHFFFAOYSA-L Synonym: sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda PubChem CID: 10340 ChEBI: CHEBI:29377 SMILES: [Na+].[Na+].[O-]C([O-])=O
| PubChem CID | 10340 |
|---|---|
| CAS | 497-19-8 |
| Molecular Weight (g/mol) | 105.99 |
| ChEBI | CHEBI:29377 |
| MDL Number | MFCD00003494 |
| SMILES | [Na+].[Na+].[O-]C([O-])=O |
| Synonym | sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda |
| InChI Key | CDBYLPFSWZWCQE-UHFFFAOYSA-L |
| Molecular Formula | CNa2O3 |
Potassium hydrogen phthalate, primary standard, ACS, 99.95-100.05%
CAS: 877-24-7 Molecular Formula: C8H5KO4 Molecular Weight (g/mol): 204.222 MDL Number: MFCD00013070 InChI Key: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC Name: potassium;2-carboxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
| PubChem CID | 23676735 |
|---|---|
| CAS | 877-24-7 |
| Molecular Weight (g/mol) | 204.222 |
| MDL Number | MFCD00013070 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
| IUPAC Name | potassium;2-carboxybenzoate |
| InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| Molecular Formula | C8H5KO4 |
Sodium Thiosulfate Solution 0.1M (0.1N), NIST Standard Solution Ready To Use, for Volumetric Analysis, Fisher Chemical™
CAS: 7772-98-7 Molecular Formula: Na2O3S2 Molecular Weight (g/mol): 158.10 MDL Number: MFCD00003499 InChI Key: AKHNMLFCWUSKQB-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium sulfanidesulfonate SMILES: [Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 61475 |
|---|---|
| CAS | 7772-98-7 |
| Molecular Weight (g/mol) | 158.10 |
| ChEBI | CHEBI:32150 |
| MDL Number | MFCD00003499 |
| SMILES | [Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium sulfanidesulfonate |
| InChI Key | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| Molecular Formula | Na2O3S2 |
Sodium thiosulfate, 0.1N Standardized Solution
CAS: 7772-98-7 Molecular Formula: Na2O3S2 Molecular Weight (g/mol): 158.10 MDL Number: MFCD00003499 InChI Key: AKHNMLFCWUSKQB-UHFFFAOYSA-L Synonym: sodium thiosulfate,sodium thiosulphate,disodium thiosulfate,sodium thiosulfate anhydrous,hypo,sodiumthiosulfate,chlorine cure,chlorine control,declor-it,thiosulfuric acid, disodium salt PubChem CID: 24477 SMILES: [Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 24477 |
|---|---|
| CAS | 7772-98-7 |
| Molecular Weight (g/mol) | 158.10 |
| MDL Number | MFCD00003499 |
| SMILES | [Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate,sodium thiosulphate,disodium thiosulfate,sodium thiosulfate anhydrous,hypo,sodiumthiosulfate,chlorine cure,chlorine control,declor-it,thiosulfuric acid, disodium salt |
| InChI Key | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| Molecular Formula | Na2O3S2 |
| Linear Formula | AgNO3 |
|---|---|
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Density | 1.0150g/mL |
| PubChem CID | 24470 |
| Name Note | 0.1 N Standard Solution |
| Fieser | 01,1008; 02,366; 03,252; 04,429; 05,582; 07,321; 09,411; 10,350; 11,268; 12,257; 14,350; 15,39 |
| Formula Weight | 169.87 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Silver nitrate |
| Grade | Pure |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Merck Index | 15, 8657 |
| Concentration or Composition (by Analyte or Components) | 0.0998 to 0.1002N (20°C) |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN: Wash with plenty of soap and water. If skin irritation occurs: Get medical advice/attention. IF IN EYES: Rinse cautiously with wa |
| MDL Number | MFCD00003414 |
| Health Hazard 2 | GHS H Statement May be corrosive to metals. Causes skin irritation. Causes serious eye irritation. Very toxic to aquatic life with long lasting effects. |
| Packaging | HDPE Bottle |
| Solubility Information | Solubility in water: miscible. |
| Health Hazard 1 | GHS Signal Word: Warning |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| Molecular Formula | AgNO3 |
| EINECS Number | 231-853-9 |
| Specific Gravity | 1.015 |
Sodium hydroxide, 5.0N Standardized Solution
CAS: 1310-73-2 Molecular Formula: HNaO Molecular Weight (g/mol): 39.997 MDL Number: MFCD00003548 InChI Key: HEMHJVSKTPXQMS-UHFFFAOYSA-M Synonym: sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic PubChem CID: 14798 ChEBI: CHEBI:32145 IUPAC Name: sodium;hydroxide SMILES: [OH-].[Na+]
| PubChem CID | 14798 |
|---|---|
| CAS | 1310-73-2 |
| Molecular Weight (g/mol) | 39.997 |
| ChEBI | CHEBI:32145 |
| MDL Number | MFCD00003548 |
| SMILES | [OH-].[Na+] |
| Synonym | sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic |
| IUPAC Name | sodium;hydroxide |
| InChI Key | HEMHJVSKTPXQMS-UHFFFAOYSA-M |
| Molecular Formula | HNaO |
Sodium Thiosulfate Solution 0.1M (0.1N), NIST Standard Solution Ready To Use, for Volumetric Analysis, Fisher Chemical™
H10Na2O8S2, CAS Number-10102-17-7, ametox, antichlor, ccris 3952, disodium thiosulfate pentahydrate, sodium hyposulfite pentahydrate, sodium thiosulfate pentahydrate, sodium thiosulfate, pentahydrate, thiosulfuric acid, disodium salt, pentahydrate, tinver, unii-hx1032v43m, 1L, CHEBI:32150 | CAS: 10102-17-7 | H10Na2O8S2 | 248.172 g/mol
Silver nitrate, 0.1N Standardized Solution
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC Name: silver(1+) nitrate SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
| Packaging | Plastic bottle |
|---|---|
| Physical Form | Liquid |
| Chemical Name or Material | Ringer's Solution |
| Synonym | dihydrogen oxide,dihydrogen monoxide |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
Calcium carbonate, ACS reagent, chelometric standard
CAS: 471-34-1 Molecular Formula: CCaO3 Molecular Weight (g/mol): 100.09 MDL Number: MFCD00010906 InChI Key: VTYYLEPIZMXCLO-UHFFFAOYSA-L Synonym: calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama PubChem CID: 10112 ChEBI: CHEBI:3311 SMILES: [Ca++].[O-]C([O-])=O
| PubChem CID | 10112 |
|---|---|
| CAS | 471-34-1 |
| Molecular Weight (g/mol) | 100.09 |
| ChEBI | CHEBI:3311 |
| MDL Number | MFCD00010906 |
| SMILES | [Ca++].[O-]C([O-])=O |
| Synonym | calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama |
| InChI Key | VTYYLEPIZMXCLO-UHFFFAOYSA-L |
| Molecular Formula | CCaO3 |
Ammonium hydroxide, 5.0N Standardized Solution
CAS: 1336-21-6 Molecular Formula: H5NO Molecular Weight (g/mol): 35.05 MDL Number: MFCD00066650 InChI Key: VHUUQVKOLVNVRT-UHFFFAOYSA-N Synonym: ammonium hydroxide,ammonia water,ammonia aqueous,aquammonia,aqua ammonia,ammonia, aqua,household ammonia,ammonium hydroxide solution,ammonia, monohydrate,ammonium hydroxide nh4 oh PubChem CID: 14923 ChEBI: CHEBI:18219 IUPAC Name: amine hydrate SMILES: N.O
| PubChem CID | 14923 |
|---|---|
| CAS | 1336-21-6 |
| Molecular Weight (g/mol) | 35.05 |
| ChEBI | CHEBI:18219 |
| MDL Number | MFCD00066650 |
| SMILES | N.O |
| Synonym | ammonium hydroxide,ammonia water,ammonia aqueous,aquammonia,aqua ammonia,ammonia, aqua,household ammonia,ammonium hydroxide solution,ammonia, monohydrate,ammonium hydroxide nh4 oh |
| IUPAC Name | amine hydrate |
| InChI Key | VHUUQVKOLVNVRT-UHFFFAOYSA-N |
| Molecular Formula | H5NO |