Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Oil, for heat transfer
CAS: 64742-65- Molecular Formula: C16H10N2Na2O7S2 Molecular Weight (g/mol): 452.363 MDL Number: MFCD00147787 InChI Key: AEOVEGJBKQQFOP-DDVLFWKVSA-L Synonym: acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g PubChem CID: 9566064 IUPAC Name: disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate SMILES: C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 9566064 |
|---|---|
| CAS | 64742-65- |
| Molecular Weight (g/mol) | 452.363 |
| MDL Number | MFCD00147787 |
| SMILES | C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g |
| IUPAC Name | disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate |
| InChI Key | AEOVEGJBKQQFOP-DDVLFWKVSA-L |
| Molecular Formula | C16H10N2Na2O7S2 |
Creatinine, 98%
CAS: 60-27-5 Molecular Formula: C4H7N3O Molecular Weight (g/mol): 113.12 InChI Key: DDRJAANPRJIHGJ-UHFFFAOYSA-N Synonym: creatinine,2-imino-1-methylimidazolidin-4-one,1-methylglycocyamidine,1-methylhydantoin-2-imide,creatinine,heated,4h-imidazol-4-one, 2-amino-1,5-dihydro-1-methyl,2-amino-1-methylimidazolin-4-one,creatinina,kreatinin,unii-ayi8ex34eu PubChem CID: 588 ChEBI: CHEBI:16737 IUPAC Name: 2-amino-3-methyl-4H-imidazol-5-one SMILES: CN1CC(=O)N=C1N
| PubChem CID | 588 |
|---|---|
| CAS | 60-27-5 |
| Molecular Weight (g/mol) | 113.12 |
| ChEBI | CHEBI:16737 |
| SMILES | CN1CC(=O)N=C1N |
| Synonym | creatinine,2-imino-1-methylimidazolidin-4-one,1-methylglycocyamidine,1-methylhydantoin-2-imide,creatinine,heated,4h-imidazol-4-one, 2-amino-1,5-dihydro-1-methyl,2-amino-1-methylimidazolin-4-one,creatinina,kreatinin,unii-ayi8ex34eu |
| IUPAC Name | 2-amino-3-methyl-4H-imidazol-5-one |
| InChI Key | DDRJAANPRJIHGJ-UHFFFAOYSA-N |
| Molecular Formula | C4H7N3O |
Undecanal, 97%
CAS: 112-44-7 Molecular Formula: C11H22O Molecular Weight (g/mol): 170.296 MDL Number: MFCD00007016 InChI Key: KMPQYAYAQWNLME-UHFFFAOYSA-N Synonym: undecanaldehyde,n-undecanal,undecyl aldehyde,undecylic aldehyde,1-undecanal,undecylaldehyde,hendecanal,hendecanaldehyde,aldehyde c-11,n-undecyl aldehyde PubChem CID: 8186 ChEBI: CHEBI:46202 IUPAC Name: undecanal SMILES: CCCCCCCCCCC=O
| PubChem CID | 8186 |
|---|---|
| CAS | 112-44-7 |
| Molecular Weight (g/mol) | 170.296 |
| ChEBI | CHEBI:46202 |
| MDL Number | MFCD00007016 |
| SMILES | CCCCCCCCCCC=O |
| Synonym | undecanaldehyde,n-undecanal,undecyl aldehyde,undecylic aldehyde,1-undecanal,undecylaldehyde,hendecanal,hendecanaldehyde,aldehyde c-11,n-undecyl aldehyde |
| IUPAC Name | undecanal |
| InChI Key | KMPQYAYAQWNLME-UHFFFAOYSA-N |
| Molecular Formula | C11H22O |
Methyl nicotinate, 99%
CAS: 93-60-7 Molecular Formula: C7H7NO2 Molecular Weight (g/mol): 137.138 MDL Number: MFCD00006388 InChI Key: YNBADRVTZLEFNH-UHFFFAOYSA-N Synonym: methyl nicotinate,nikomet,methylnicotinate,nicotinic acid methyl ester,nicometh,methyl 3-pyridinecarboxylate,methyl-nicotinate,3-pyridinecarboxylic acid, methyl ester,heat spray,nicotinic acid, methyl ester PubChem CID: 7151 IUPAC Name: methyl pyridine-3-carboxylate SMILES: COC(=O)C1=CN=CC=C1
| PubChem CID | 7151 |
|---|---|
| CAS | 93-60-7 |
| Molecular Weight (g/mol) | 137.138 |
| MDL Number | MFCD00006388 |
| SMILES | COC(=O)C1=CN=CC=C1 |
| Synonym | methyl nicotinate,nikomet,methylnicotinate,nicotinic acid methyl ester,nicometh,methyl 3-pyridinecarboxylate,methyl-nicotinate,3-pyridinecarboxylic acid, methyl ester,heat spray,nicotinic acid, methyl ester |
| IUPAC Name | methyl pyridine-3-carboxylate |
| InChI Key | YNBADRVTZLEFNH-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO2 |
Methyl nicotinate, 99%
CAS: 93-60-7 Molecular Formula: C7H7NO2 Molecular Weight (g/mol): 137.14 MDL Number: MFCD00006388 InChI Key: YNBADRVTZLEFNH-UHFFFAOYSA-N Synonym: methyl nicotinate,nikomet,methylnicotinate,nicotinic acid methyl ester,nicometh,methyl 3-pyridinecarboxylate,methyl-nicotinate,3-pyridinecarboxylic acid, methyl ester,heat spray,nicotinic acid, methyl ester PubChem CID: 7151 IUPAC Name: methyl pyridine-3-carboxylate SMILES: COC(=O)C1=CN=CC=C1
| PubChem CID | 7151 |
|---|---|
| CAS | 93-60-7 |
| Molecular Weight (g/mol) | 137.14 |
| MDL Number | MFCD00006388 |
| SMILES | COC(=O)C1=CN=CC=C1 |
| Synonym | methyl nicotinate,nikomet,methylnicotinate,nicotinic acid methyl ester,nicometh,methyl 3-pyridinecarboxylate,methyl-nicotinate,3-pyridinecarboxylic acid, methyl ester,heat spray,nicotinic acid, methyl ester |
| IUPAC Name | methyl pyridine-3-carboxylate |
| InChI Key | YNBADRVTZLEFNH-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO2 |
3-Chloroperoxybenzoic Acid, 70-75%, balance 3-Chlorobenzoic Acid and water
3-Chloroperoxybenzoic acid, 70-75%, C7H5ClO3, CAS Number-937-14-4, 535-80-8, 7732-18-5 | CAS: 937-14-4 | C7H5ClO3 | 172.56 g/mol
| Linear Formula | ClC6H4CO3H |
|---|---|
| Molecular Weight (g/mol) | 172.56 |
| ChEBI | CHEBI:52091 |
| CAS Min % | 25.0 |
| InChI Key | NHQDETIJWKXCTC-UHFFFAOYSA-N |
| Density | 0.5600g/mL |
| PubChem CID | 70297 |
| Name Note | 70 - 75% |
| Percent Purity | 70-75% |
| Fieser | 01,135; 02,68; 03,49; 04,85; 05,120; 06,110; 07,62; 08,97; 09,108; 10,92; 11,122; 12,118; 13,76; 15,86; 16,80; 17,76 |
| RTECS Number | SD9470000 |
| Formula Weight | 172.57 |
| Melting Point | 92.0°C to 94.0°C |
| CAS Max % | 30.0 |
| Color | White |
| Physical Form | Moist Powder |
| SMILES | OOC(=O)C1=CC=CC(Cl)=C1 |
| Merck Index | 15,2154 |
| Assay Percent Range | di-m-Chlorobenzoyl peroxide: < 0.1% Typical (HPLC) |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Keep/Store away from clothing/ combustible materials. IF SWALLOWED: rin |
| MDL Number | MFCD00002127 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. Heating may cause a fire. |
| Solubility Information | Solubility in water: insoluble. Other solubilities: soluble in koh, soluble in chloroform and acetone |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | 3-chloroperoxybenzoic acid,3-chloroperbenzoic acid,mcpba,m-chloroperbenzoic acid,m-chloroperoxybenzoic acid,meta-chloroperoxybenzoic acid,benzenecarboperoxoic acid, 3-chloro,m-chlorobenzoyl hydroperoxide,meta-chloroperbenzoic acid,3-chlorobenzoperoxoic acid |
| TSCA | TSCA |
| IUPAC Name | 3-chlorobenzenecarboperoxoic acid |
| Beilstein | 09,IV,972 |
| Molecular Formula | C7H5ClO3 |
| EINECS Number | 213-322-3 |
| Specific Gravity | 0.56 |
Sodium tert-butoxide, 99%, pure
CAS: 865-48-5 Molecular Formula: C4H9NaO Molecular Weight (g/mol): 96.1 MDL Number: MFCD00040575 InChI Key: MFRIHAYPQRLWNB-UHFFFAOYSA-N Synonym: sodium tert-butoxide,sodium 2-methylpropan-2-olate,sodium t-butoxide,sodium-t-butoxide,t-butoxy sodium,tert-butoxysodium,naotbu,tbuona,2-propanol, 2-methyl-, sodium salt,sodium-tert-butoxide PubChem CID: 23676156 IUPAC Name: sodium;2-methylpropan-2-olate SMILES: CC(C)(C)[O-].[Na+]
| PubChem CID | 23676156 |
|---|---|
| CAS | 865-48-5 |
| Molecular Weight (g/mol) | 96.1 |
| MDL Number | MFCD00040575 |
| SMILES | CC(C)(C)[O-].[Na+] |
| Synonym | sodium tert-butoxide,sodium 2-methylpropan-2-olate,sodium t-butoxide,sodium-t-butoxide,t-butoxy sodium,tert-butoxysodium,naotbu,tbuona,2-propanol, 2-methyl-, sodium salt,sodium-tert-butoxide |
| IUPAC Name | sodium;2-methylpropan-2-olate |
| InChI Key | MFRIHAYPQRLWNB-UHFFFAOYSA-N |
| Molecular Formula | C4H9NaO |
4-Methylbenzenesulfonhydrazide, 97%
CAS: 1576-35-8 Molecular Formula: C7H10N2O2S Molecular Weight (g/mol): 186.23 MDL Number: MFCD00007588 InChI Key: ICGLPKIVTVWCFT-UHFFFAOYSA-N Synonym: 4-methylbenzenesulfonhydrazide,p-toluenesulfonhydrazide,tosylhydrazine,p-toluenesulfonyl hydrazide,tosylhydrazide,p-tosylhydrazine,p-toluenesulfonylhydrazine,celogen tsh,ptsh,4-toluenesulfonyl hydrazide PubChem CID: 15303 SMILES: CC1=CC=C(C=C1)S(=O)(=O)NN
| PubChem CID | 15303 |
|---|---|
| CAS | 1576-35-8 |
| Molecular Weight (g/mol) | 186.23 |
| MDL Number | MFCD00007588 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NN |
| Synonym | 4-methylbenzenesulfonhydrazide,p-toluenesulfonhydrazide,tosylhydrazine,p-toluenesulfonyl hydrazide,tosylhydrazide,p-tosylhydrazine,p-toluenesulfonylhydrazine,celogen tsh,ptsh,4-toluenesulfonyl hydrazide |
| InChI Key | ICGLPKIVTVWCFT-UHFFFAOYSA-N |
| Molecular Formula | C7H10N2O2S |
Piperidine, 99%, extra pure
CAS: 110-89-4 Molecular Formula: C5H11N Molecular Weight (g/mol): 85.15 InChI Key: NQRYJNQNLNOLGT-UHFFFAOYSA-N IUPAC Name: piperidine SMILES: C1CCNCC1
| CAS | 110-89-4 |
|---|---|
| Molecular Weight (g/mol) | 85.15 |
| SMILES | C1CCNCC1 |
| IUPAC Name | piperidine |
| InChI Key | NQRYJNQNLNOLGT-UHFFFAOYSA-N |
| Molecular Formula | C5H11N |
PyOxim, 97%, Thermo Scientific™
CAS: 153433-21-7 Molecular Formula: C17H29F6N5O3P2 Molecular Weight (g/mol): 527.39 MDL Number: MFCD18643381 InChI Key: RDWDVLFMPFUBDV-UHFFFAOYSA-N Synonym: pyoxim,pyoxime,ethyl cyano hydroxyimino acetato-tri-1-pyrrolidinyl-phosphonium hexafluorophosphate,cyano-ethoxycarbonyl methyleneaminooxy tris 1-pyrrolidinyl phosphonium hexafluorophosphate PubChem CID: 46910530 IUPAC Name: [(E)-(1-cyano-2-ethoxy-2-oxoethylidene)amino]oxy-tripyrrolidin-1-ylphosphanium;hexafluorophosphate SMILES: F[P-](F)(F)(F)(F)F.CCOC(=O)C(=NO[P+](N1CCCC1)(N1CCCC1)N1CCCC1)C#N
| PubChem CID | 46910530 |
|---|---|
| CAS | 153433-21-7 |
| Molecular Weight (g/mol) | 527.39 |
| MDL Number | MFCD18643381 |
| SMILES | F[P-](F)(F)(F)(F)F.CCOC(=O)C(=NO[P+](N1CCCC1)(N1CCCC1)N1CCCC1)C#N |
| Synonym | pyoxim,pyoxime,ethyl cyano hydroxyimino acetato-tri-1-pyrrolidinyl-phosphonium hexafluorophosphate,cyano-ethoxycarbonyl methyleneaminooxy tris 1-pyrrolidinyl phosphonium hexafluorophosphate |
| IUPAC Name | [(E)-(1-cyano-2-ethoxy-2-oxoethylidene)amino]oxy-tripyrrolidin-1-ylphosphanium;hexafluorophosphate |
| InChI Key | RDWDVLFMPFUBDV-UHFFFAOYSA-N |
| Molecular Formula | C17H29F6N5O3P2 |
Dibenzoyl peroxide, 75%, remainder water
CAS: 94-36-0 Molecular Formula: C14H10O4 Molecular Weight (g/mol): 242.23 MDL Number: MFCD00003071 InChI Key: OMPJBNCRMGITSC-UHFFFAOYSA-N Synonym: benzoyl peroxide,dibenzoyl peroxide,peroxide, dibenzoyl,benzoperoxide,benzoyl superoxide,acetoxyl,lucidol,benoxyl,panoxyl,benzol peroxide PubChem CID: 7187 ChEBI: CHEBI:82405 IUPAC Name: benzoyl benzenecarboperoxoate SMILES: C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2
| PubChem CID | 7187 |
|---|---|
| CAS | 94-36-0 |
| Molecular Weight (g/mol) | 242.23 |
| ChEBI | CHEBI:82405 |
| MDL Number | MFCD00003071 |
| SMILES | C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2 |
| Synonym | benzoyl peroxide,dibenzoyl peroxide,peroxide, dibenzoyl,benzoperoxide,benzoyl superoxide,acetoxyl,lucidol,benoxyl,panoxyl,benzol peroxide |
| IUPAC Name | benzoyl benzenecarboperoxoate |
| InChI Key | OMPJBNCRMGITSC-UHFFFAOYSA-N |
| Molecular Formula | C14H10O4 |
Thermo Scientific Chemicals Famciclovir
CAS: 104227-87-4 Molecular Formula: C14H19N5O4 Molecular Weight (g/mol): 321.34 MDL Number: MFCD00866964 InChI Key: GGXKWVWZWMLJEH-UHFFFAOYSA-N IUPAC Name: 2-[(acetyloxy)methyl]-4-(2-amino-9H-purin-9-yl)butyl acetate SMILES: CC(=O)OCC(CCN1C=NC2=CN=C(N)N=C12)COC(C)=O
| CAS | 104227-87-4 |
|---|---|
| Molecular Weight (g/mol) | 321.34 |
| MDL Number | MFCD00866964 |
| SMILES | CC(=O)OCC(CCN1C=NC2=CN=C(N)N=C12)COC(C)=O |
| IUPAC Name | 2-[(acetyloxy)methyl]-4-(2-amino-9H-purin-9-yl)butyl acetate |
| InChI Key | GGXKWVWZWMLJEH-UHFFFAOYSA-N |
| Molecular Formula | C14H19N5O4 |
Dilauroyl peroxide, 99%
CAS: 105-74-8 Molecular Formula: C24H46O4 Molecular Weight (g/mol): 398.63 MDL Number: MFCD00008964 InChI Key: YIVJZNGAASQVEM-UHFFFAOYSA-N Synonym: lauroyl peroxide,dilauroyl peroxide,dodecanoyl peroxide,peroxide, bis 1-oxododecyl,laurydol,laurox,alperox c,dodecanoic peroxyanhydride,dyp-97f,peroxyde de lauroyle PubChem CID: 7773 ChEBI: CHEBI:82479 IUPAC Name: dodecanoyl dodecaneperoxoate SMILES: CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC
| PubChem CID | 7773 |
|---|---|
| CAS | 105-74-8 |
| Molecular Weight (g/mol) | 398.63 |
| ChEBI | CHEBI:82479 |
| MDL Number | MFCD00008964 |
| SMILES | CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC |
| Synonym | lauroyl peroxide,dilauroyl peroxide,dodecanoyl peroxide,peroxide, bis 1-oxododecyl,laurydol,laurox,alperox c,dodecanoic peroxyanhydride,dyp-97f,peroxyde de lauroyle |
| IUPAC Name | dodecanoyl dodecaneperoxoate |
| InChI Key | YIVJZNGAASQVEM-UHFFFAOYSA-N |
| Molecular Formula | C24H46O4 |
| Molecular Weight (g/mol) | 229.70 |
|---|---|
| Chemical Name or Material | Tetraethylammonium perchlorate |
| SMILES | [O-][Cl](=O)(=O)=O.CC[N+](CC)(CC)CC |
| InChI Key | WGHUNMFFLAMBJD-UHFFFAOYSA-M |
| Density | 1.0016g/mL |
| PubChem CID | 2734932 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement: Keep away from heat/sparks/open flames/hot surfaces. - No smoking. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00041977 |
| Health Hazard 2 | GHS H Statement: May intensify fire; oxidizer. Risk of explosion if heated under confinement. |
| Packaging | Plastic bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetraethylammonium perchlorate,ethanaminium, n,n,n-triethyl-, perchlorate,tetraethylazanium perchlorate,ethanaminium, n,n,n-triethyl-, perchlorate 1:1,ammonium, tetraethyl-, perchlorate,tetraethylammoniumperchlorate,acmc-1ccq7,ksc203k4p,tetraethyl ammonium perchlorate,tetraethylammoniumperchlorate, dry |
| IUPAC Name | tetraethylazanium;perchlorate |
| Molecular Formula | C8H20ClNO4 |
| EINECS Number | 219-904-3 |
| Formula Weight | 229.7 |
| Specific Gravity | 1.0016 |