Chemicals
Filtered Search Results
Sodium Hydroxide Solution 0.1M (0.1N), NIST Standard Solution ready to use, for volumetric analysis, meets analytical specification of Ph.Eur., BP, Fisher Chemical™
CAS: 1310-73-2 Molecular Formula: HNaO Molecular Weight (g/mol): 39.997 MDL Number: 3548 InChI Key: HEMHJVSKTPXQMS-UHFFFAOYSA-M Synonym: sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic PubChem CID: 14798 ChEBI: CHEBI:32145 IUPAC Name: sodium;hydroxide SMILES: [OH-].[Na+]
| PubChem CID | 14798 |
|---|---|
| CAS | 1310-73-2 |
| Molecular Weight (g/mol) | 39.997 |
| ChEBI | CHEBI:32145 |
| MDL Number | 3548 |
| SMILES | [OH-].[Na+] |
| Synonym | sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic |
| IUPAC Name | sodium;hydroxide |
| InChI Key | HEMHJVSKTPXQMS-UHFFFAOYSA-M |
| Molecular Formula | HNaO |
Iodine, 0.1N (0.05M) standard solution
CAS: 7553-56-2 Molecular Formula: I2 Molecular Weight (g/mol): 253.81 MDL Number: MFCD00011355 MFCD00164163 InChI Key: PNDPGZBMCMUPRI-UHFFFAOYSA-N Synonym: iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode PubChem CID: 807 ChEBI: CHEBI:17606 IUPAC Name: diiodine SMILES: II
| PubChem CID | 807 |
|---|---|
| CAS | 7553-56-2 |
| Molecular Weight (g/mol) | 253.81 |
| ChEBI | CHEBI:17606 |
| MDL Number | MFCD00011355 MFCD00164163 |
| SMILES | II |
| Synonym | iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode |
| IUPAC Name | diiodine |
| InChI Key | PNDPGZBMCMUPRI-UHFFFAOYSA-N |
| Molecular Formula | I2 |
| Linear Formula | Na2S2O3 |
|---|---|
| Molecular Weight (g/mol) | 158.10 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Sodium thiosulfate |
| SMILES | [Na+].[Na+].[O-]S([S-])(=O)=O |
| Merck Index | 15, 8821 |
| InChI Key | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| PubChem CID | 24477 |
| Concentration or Composition (by Analyte or Components) | 0.0950 to 0.1050N (20°C) |
| CAS | 7732-18-5 |
| MDL Number | MFCD00003499 |
| Health Hazard 1 | |
| Synonym | sodium thiosulfate,sodium thiosulphate,disodium thiosulfate,sodium thiosulfate anhydrous,hypo,sodiumthiosulfate,chlorine cure,chlorine control,declor-it,thiosulfuric acid, disodium salt |
| Molecular Formula | Na2O3S2 |
| Formula Weight | 158.11 |
Ethylenediaminetetraacetic acid disodium salt, 0.100N (0.050M) Standardized solution
CAS: 139-33-3 Molecular Formula: C10H14N2Na2O8 Molecular Weight (g/mol): 336.21 MDL Number: MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 InChI Key: ZGTMUACCHSMWAC-UHFFFAOYSA-L Synonym: ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid PubChem CID: 57339238 ChEBI: CHEBI:64734 IUPAC Name: disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate SMILES: [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 57339238 |
|---|---|
| CAS | 139-33-3 |
| Molecular Weight (g/mol) | 336.21 |
| ChEBI | CHEBI:64734 |
| MDL Number | MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 |
| SMILES | [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid |
| IUPAC Name | disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate |
| InChI Key | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
| Molecular Formula | C10H14N2Na2O8 |
Potassium thiocyanate, 0.1N Standardized Solution
CAS: 333-20-0 Molecular Formula: CKNS Molecular Weight (g/mol): 97.176 MDL Number: MFCD00011413 InChI Key: ZNNZYHKDIALBAK-UHFFFAOYSA-M Synonym: potassium thiocyanate,potassium rhodanate,potassium rhodanide,rodanca,potassium sulfocyanate,rhodanide,rhocya,potassium thiocyanide,kscn,thiocyanic acid, potassium salt PubChem CID: 516872 ChEBI: CHEBI:30951 IUPAC Name: potassium;thiocyanate SMILES: C(#N)[S-].[K+]
| PubChem CID | 516872 |
|---|---|
| CAS | 333-20-0 |
| Molecular Weight (g/mol) | 97.176 |
| ChEBI | CHEBI:30951 |
| MDL Number | MFCD00011413 |
| SMILES | C(#N)[S-].[K+] |
| Synonym | potassium thiocyanate,potassium rhodanate,potassium rhodanide,rodanca,potassium sulfocyanate,rhodanide,rhocya,potassium thiocyanide,kscn,thiocyanic acid, potassium salt |
| IUPAC Name | potassium;thiocyanate |
| InChI Key | ZNNZYHKDIALBAK-UHFFFAOYSA-M |
| Molecular Formula | CKNS |
Sodium carbonate, ACS primary standard, 99.95-100.05% (dried basis)
CAS: 497-19-8 Molecular Formula: CNa2O3 Molecular Weight (g/mol): 105.99 MDL Number: MFCD00003494 InChI Key: CDBYLPFSWZWCQE-UHFFFAOYSA-L Synonym: sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda PubChem CID: 10340 ChEBI: CHEBI:29377 SMILES: [Na+].[Na+].[O-]C([O-])=O
| PubChem CID | 10340 |
|---|---|
| CAS | 497-19-8 |
| Molecular Weight (g/mol) | 105.99 |
| ChEBI | CHEBI:29377 |
| MDL Number | MFCD00003494 |
| SMILES | [Na+].[Na+].[O-]C([O-])=O |
| Synonym | sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda |
| InChI Key | CDBYLPFSWZWCQE-UHFFFAOYSA-L |
| Molecular Formula | CNa2O3 |
Potassium hydrogen phthalate, primary standard, ACS, 99.95-100.05%
CAS: 877-24-7 Molecular Formula: C8H5KO4 Molecular Weight (g/mol): 204.222 MDL Number: MFCD00013070 InChI Key: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC Name: potassium;2-carboxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
| PubChem CID | 23676735 |
|---|---|
| CAS | 877-24-7 |
| Molecular Weight (g/mol) | 204.222 |
| MDL Number | MFCD00013070 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
| IUPAC Name | potassium;2-carboxybenzoate |
| InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| Molecular Formula | C8H5KO4 |
Starch indicator solution 1%, Acculute Standard Volumetric Solution, Final Volume 1L
For Iodometric Titrations | CAS: 9005-84-9
| Concentration or Composition (by Analyte or Components) | Starch: 20%; Water: 80% |
|---|---|
| CAS | 7732-18-5 |
| MDL Number | MFCD00082026 |
| Solubility Information | Miscible with water. |
| Physical Form | Liquid,For iodometric titrations |
| Chemical Name or Material | Starch indicator solution |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Vapor Pressure | 17mm Hg at 20°C |
| Assay Percent Range | 100% |
Sodium Thiosulfate Solution 0.1M (0.1N), NIST Standard Solution Ready To Use, for Volumetric Analysis, Fisher Chemical™
CAS: 7772-98-7 Molecular Formula: Na2O3S2 Molecular Weight (g/mol): 158.10 MDL Number: MFCD00003499 InChI Key: AKHNMLFCWUSKQB-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium sulfanidesulfonate SMILES: [Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 61475 |
|---|---|
| CAS | 7772-98-7 |
| Molecular Weight (g/mol) | 158.10 |
| ChEBI | CHEBI:32150 |
| MDL Number | MFCD00003499 |
| SMILES | [Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium sulfanidesulfonate |
| InChI Key | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| Molecular Formula | Na2O3S2 |
| Linear Formula | HCl |
|---|---|
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Hydrochloric acid |
| SMILES | Cl |
| Merck Index | 15, 4818 |
| Concentration | 0.998 to 1.002N (20°C) |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Density | 1.0200g/mL |
| PubChem CID | 313 |
| Name Note | 1N standard solution |
| Fieser | 04,450; 05,533; 06,283 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement: Keep only in original container. Absorb spillage to prevent material damage. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00011324 MFCD00792839 |
| Health Hazard 2 | GHS H Statement: May be corrosive to metals. |
| Health Hazard 1 | Warning |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| Molecular Formula | ClH |
| Linear Formula | NaOH |
|---|---|
| Molecular Weight (g/mol) | 39.997 |
| ChEBI | CHEBI:32145 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Sodium hydroxide |
| SMILES | [OH-].[Na+] |
| Merck Index | 15, 8761 |
| Concentration | 0.998 to 1.002N (20°C) |
| InChI Key | HEMHJVSKTPXQMS-UHFFFAOYSA-M |
| Density | 1.0400g/mL |
| PubChem CID | 14798 |
| Fieser | 01,1083; 05,616; 07,336; 08,460 |
| CAS | 7732-18-5 |
| Health Hazard 1 | Danger |
| Synonym | sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic |
| IUPAC Name | sodium;hydroxide |
| Molecular Formula | HNaO |
| EINECS Number | 215-185-5 |
| Formula Weight | 40 |