Learn More
(R,R)-(-)-N,N'-Bis(3,5-di-tert-butylsalicylidene)-1,2-cyclohexanediaminomanganese(III) chloride, ACROS Organics™
Brand: Acros Organics 295810010
Additional Details : CAS Number : 138124-32-0 Weight : 0.05100kg
| Quantity | 1g |
|---|
Chemical Identifiers
| 138124-32-0 | |
| 635.21 | |
| YRVXCOIDMFNGIJ-SEILFYAJSA-M | |
| 131675872 | |
| CC(C)(C)C1=CC(=CNC2CCCCC2NC=C3C=C(C=C(C3=O)C(C)(C)C)C(C)(C)C)C(=O)C(=C1)C(C)(C)C.[Cl-].[Mn] |
| C36H52ClMnN2O2 | |
| MFCD02101664 | |
| 1r,2r---1,2-cyclohexanediamino-n,n'-bis 3,5-di-t-butylsalicylidene manganese iii chloride r,r-jacobsen cat. | |
| 2,4-ditert-butyl-6-[[[(1R,2R)-2-[(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]cyclohexyl]amino]methylidene]cyclohexa-2,4-dien-1-one;manganese;chloride |
Specifications
| (R,R)-(-)-N,N'-Bis(3,5-di-tert-butylsalicylidene)-1,2-cyclohexanediaminomanganese(III) chloride | |
| Authentic | |
| Brown to Yellow | |
| 1g | |
| 97.5 | |
| 97% | |
| MFCD02101664 | |
| 1r,2r---1,2-cyclohexanediamino-n,n'-bis 3,5-di-t-butylsalicylidene manganese iii chloride r,r-jacobsen cat. | |
| CC(C)(C)C1=CC(=CNC2CCCCC2NC=C3C=C(C=C(C3=O)C(C)(C)C)C(C)(C)C)C(=O)C(=C1)C(C)(C)C.[Cl-].[Mn] | |
| 635.21 | |
| 635.21 |
| 96.0 % min. | |
| Glass bottle | |
| 330°C to 332°C | |
| 138124-32-0 | |
| 100.0 | |
| C36H52ClMnN2O2 | |
| 15, 5300 | |
| YRVXCOIDMFNGIJ-SEILFYAJSA-M | |
| 2,4-ditert-butyl-6-[[[(1R,2R)-2-[(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]cyclohexyl]amino]methylidene]cyclohexa-2,4-dien-1-one;manganese;chloride | |
| 131675872 | |
| Liquid May Develop Some Turbidity or Precipitate |