Learn More
(R,R)-(-)-N,N'-Bis(3,5-di-tert-butylsalicylidene)-1,2-cyclohexanediaminomanganese(III) chloride, ACROS Organics™
Brand: Acros Organics 295810010
Additional Details : CAS Number : 138124-32-0 Weight : 0.05100kg
Quantity | 1g |
---|
Chemical Identifiers
138124-32-0 | |
635.21 | |
YRVXCOIDMFNGIJ-SEILFYAJSA-M | |
131675872 | |
CC(C)(C)C1=CC(=CNC2CCCCC2NC=C3C=C(C=C(C3=O)C(C)(C)C)C(C)(C)C)C(=O)C(=C1)C(C)(C)C.[Cl-].[Mn] |
C36H52ClMnN2O2 | |
MFCD02101664 | |
1r,2r---1,2-cyclohexanediamino-n,n'-bis 3,5-di-t-butylsalicylidene manganese iii chloride r,r-jacobsen cat. | |
2,4-ditert-butyl-6-[[[(1R,2R)-2-[(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]cyclohexyl]amino]methylidene]cyclohexa-2,4-dien-1-one;manganese;chloride |
Specifications
(R,R)-(-)-N,N'-Bis(3,5-di-tert-butylsalicylidene)-1,2-cyclohexanediaminomanganese(III) chloride | |
Authentic | |
Brown to Yellow | |
1g | |
97.5 | |
97% | |
MFCD02101664 | |
1r,2r---1,2-cyclohexanediamino-n,n'-bis 3,5-di-t-butylsalicylidene manganese iii chloride r,r-jacobsen cat. | |
CC(C)(C)C1=CC(=CNC2CCCCC2NC=C3C=C(C=C(C3=O)C(C)(C)C)C(C)(C)C)C(=O)C(=C1)C(C)(C)C.[Cl-].[Mn] | |
635.21 | |
635.21 |
96.0 % min. | |
Glass bottle | |
330°C to 332°C | |
138124-32-0 | |
100.0 | |
C36H52ClMnN2O2 | |
15, 5300 | |
YRVXCOIDMFNGIJ-SEILFYAJSA-M | |
2,4-ditert-butyl-6-[[[(1R,2R)-2-[(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]cyclohexyl]amino]methylidene]cyclohexa-2,4-dien-1-one;manganese;chloride | |
131675872 | |
Liquid May Develop Some Turbidity or Precipitate |