Learn More
Potassium Hydrogen Phthalate, Certified AR for Analysis, Fisher Chemical™
Potassium Hydrogen Phthalate, Certified AR for Analysis, Fisher Chemical, Quantity: 500g, CAS: 877-24-7, White, Melting Point: 295 deg.C, Molecular Formula: C8H5KO4, Molecular Weight: 204.222, Packaging: Plastic powder jar, pH: 3.8 to 4.0
Brand: Fisher Chemical P/5320/50
Additional Details : CAS Number : 877-24-7 Weight : 0.25000kg
| Quantity | 250g |
|---|
Description
Potassium Hydrogen Phthalate, Certified AR for Analysis, Fisher Chemical, Quantity: 500g, CAS: 877-24-7, White, Melting Point: 295 deg.C, Molecular Formula: C8H5KO4, Molecular Weight: 204.222, Packaging: Plastic powder jar, pH: 3.8 to 4.0
Chemical Identifiers
| 877-24-7 | |
| 204.222 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| C8H5KO4 | |
| 13070 | |
| potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic | |
| potassium;2-carboxybenzoate |
Specifications
| 877-24-7 | |
| 13070 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 23676735 | |
| Solid | |
| White | |
| 3.8 to 4.0 |
| C8H5KO4 | |
| potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.222 | |
| 204.22g/mol | |
| Plastic powder jar | |
| 295°C | |
| 250g |