Learn More
3-Phenyltoluene, 95%, ACROS Organics™
Brand: Acros Organics 309840050
Additional Details : CAS Number : 643-93-6 Weight : 0.05500kg
Packaging | Glass bottle |
---|---|
Quantity | 5g |
Chemical Identifiers
643-93-6 | |
168.24 | |
NPDIDUXTRAITDE-UHFFFAOYSA-N | |
12564 | |
CC1=CC=CC(=C1)C2=CC=CC=C2 |
C13H12 | |
MFCD00008533 | |
3-methylbiphenyl, 3-phenyltoluene, 3-methyl-1,1'biphenyl, 1,1'-biphenyl, 3-methyl, 3-methyl-1,1'-biphenyl, biphenyl, 3-methyl, unii-kfp6eo4j6p, kfp6eo4j6p, 1-methyl-3-phenyl-benzene, 3-methyl-biphenyl | |
1-methyl-3-phenylbenzene |
Specifications
3-Phenyltoluene | |
>110°C | |
Glass bottle | |
1.01 | |
Yellow | |
5g | |
94.0 | |
94% min. (GC) | |
C6H5C6H4CH3 | |
3-methylbiphenyl, 3-phenyltoluene, 3-methyl-1,1'biphenyl, 1,1'-biphenyl, 3-methyl, 3-methyl-1,1'-biphenyl, biphenyl, 3-methyl, unii-kfp6eo4j6p, kfp6eo4j6p, 1-methyl-3-phenyl-benzene, 3-methyl-biphenyl | |
CC1=CC=CC(=C1)C2=CC=CC=C2 | |
168.24 | |
168.24 | |
95% |
1.0100g/mL | |
Authentic | |
1.6010 to 1.605 | |
272°C | |
4°C to 5°C | |
643-93-6 | |
100.0 | |
C13H12 | |
MFCD00008533 | |
NPDIDUXTRAITDE-UHFFFAOYSA-N | |
1-methyl-3-phenylbenzene | |
12564 | |
Liquid |