Learn More
3-Phenyltoluene, 95%, ACROS Organics™
Brand: Acros Organics 309840010
Additional Details : CAS Number : 643-93-6 Weight : 0.05100kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 1g |
Chemical Identifiers
| 643-93-6 | |
| 168.24 | |
| NPDIDUXTRAITDE-UHFFFAOYSA-N | |
| 12564 | |
| CC1=CC=CC(=C1)C2=CC=CC=C2 |
| C13H12 | |
| MFCD00008533 | |
| 3-methylbiphenyl, 3-phenyltoluene, 3-methyl-1,1'biphenyl, 1,1'-biphenyl, 3-methyl, 3-methyl-1,1'-biphenyl, biphenyl, 3-methyl, unii-kfp6eo4j6p, kfp6eo4j6p, 1-methyl-3-phenyl-benzene, 3-methyl-biphenyl | |
| 1-methyl-3-phenylbenzene |
Specifications
| 3-Phenyltoluene | |
| >110°C | |
| Glass bottle | |
| 1.01 | |
| Yellow | |
| 1g | |
| 94.0 | |
| 94% min. (GC) | |
| C6H5C6H4CH3 | |
| 3-methylbiphenyl, 3-phenyltoluene, 3-methyl-1,1'biphenyl, 1,1'-biphenyl, 3-methyl, 3-methyl-1,1'-biphenyl, biphenyl, 3-methyl, unii-kfp6eo4j6p, kfp6eo4j6p, 1-methyl-3-phenyl-benzene, 3-methyl-biphenyl | |
| CC1=CC=CC(=C1)C2=CC=CC=C2 | |
| 168.24 | |
| 168.24 | |
| 95% |
| 1.0100g/mL | |
| Authentic | |
| 1.6010 to 1.605 | |
| 272°C | |
| 4°C to 5°C | |
| 643-93-6 | |
| 100.0 | |
| C13H12 | |
| MFCD00008533 | |
| NPDIDUXTRAITDE-UHFFFAOYSA-N | |
| 1-methyl-3-phenylbenzene | |
| 12564 | |
| Liquid |