Learn More
1,3-Phenylenediacetic acid, 97%, ACROS Organics™
Brand: Acros Organics 130500050
Additional Details : CAS Number : 19806-17-8 Weight : 0.05500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 5g |
Chemical Identifiers
| 19806-17-8 | |
| 194.19 | |
| GDYYIJNDPMFMTB-UHFFFAOYSA-N | |
| 29788 | |
| OC(=O)CC1=CC(CC(O)=O)=CC=C1 |
| C10H10O4 | |
| MFCD00004341 | |
| 2,2'-1,3-phenylene diacetic acid, 1,3-phenylenediacetic acid, m-benzenediacetic acid, m-phenylenediacetic acid, 1,3-benzenediacetic acid, acetic acid, 2,2'-m-phenylene di, 2-3-carboxymethyl phenyl acetic acid, 1,3-benzenediaceticacid, 3-carboxymethyl phenyl acetic acid, 1,3-benzoldiessigsaure | |
| 2-[3-(carboxymethyl)phenyl]acetic acid |
Specifications
| 1, 3-Phenylenediacetic acid | |
| Glass bottle | |
| 173°C to 177°C | |
| 19806-17-8 | |
| 100.0 | |
| C10H10O4 | |
| MFCD00004341 | |
| 2,2'-1,3-phenylene diacetic acid, 1,3-phenylenediacetic acid, m-benzenediacetic acid, m-phenylenediacetic acid, 1,3-benzenediacetic acid, acetic acid, 2,2'-m-phenylene di, 2-3-carboxymethyl phenyl acetic acid, 1,3-benzenediaceticacid, 3-carboxymethyl phenyl acetic acid, 1,3-benzoldiessigsaure | |
| OC(=O)CC1=CC(CC(O)=O)=CC=C1 | |
| 194.19 | |
| 194.19 | |
| 97% |
| Authentic | |
| White to Yellow | |
| 5g | |
| 96.0 | |
| 97% | |
| C6H4(CH2CO2H)2 | |
| 09, 874 | |
| GDYYIJNDPMFMTB-UHFFFAOYSA-N | |
| 2-[3-(carboxymethyl)phenyl]acetic acid | |
| 29788 | |
| Fine Crystalline Powder |
Safety and Handling
- 1,3-Phenylenediacetic acid
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.